BindingDB logo
myBDB logout

8 SMILES Strings for Neuronal acetylcholine receptor subunit beta-4

Compound NameSMILES String
BDBM82070 CN1CCC[C@H]1c1cccnc1 |r|
BDBM50023330 CC(=O)C1=CCCC2CCC1N2 |t:3,THB:1:3:11:9.8|
BDBM50049757 Clc1ccc(cn1)C1CC2CCC1N2 |TLB:4:7:11.10:13|
BDBM50110258 Clc1ccc(cn1)C1=CCC[C@H]2CCC1N2 |t:8,THB:4:7:15:13.12|
BDBM50110259 C1CC2N[C@H]1CCC=C2c1cncnc1 |c:8,THB:9:8:3:1.0|
BDBM50110260 C1CC2N[C@H]1CCC=C2c1cccnc1 |c:8,THB:9:8:3:1.0|
BDBM50110262 C1CC2N[C@H]1CCC=C2c1ccnnc1 |c:8,THB:9:8:3:1.0|
BDBM50110263 C1CC2N[C@H]1CCC=C2c1cnccn1 |c:8,THB:9:8:3:1.0|