BindingDB logo
myBDB logout

1 SMILES String for Neuronal nicotinic acetylcholine receptor

Compound NameSMILES String
BDBM50000483 CN1C2CCCC1CC(C2)NC(=O)c1nn(C)c2ccccc12 |THB:10:8:1:3.5.4|