BindingDB logo
myBDB logout

19 SMILES Strings for Neuropeptide Y receptor type 5

Compound NameSMILES String
BDBM50089038 Nc1nc(NC[C@H]2CC[C@H](CNS(=O)(=O)c3cccc4ccccc34)CC2)nc2ccccc12 |wU:6.5,wD:9.9,(2.92,.42,;2.94,-1.13,;4.28,-1.89,;4.29,-3.44,;5.63,-4.22,;6.96,-3.45,;8.29,-4.21,;9.63,-3.44,;10.96,-4.22,;10.95,-5.76,;12.28,-6.54,;13.77,-6.13,;14.86,-7.21,;13.98,-8.47,;15.7,-5.91,;16.12,-8.05,;17.24,-7,;18.73,-7.45,;19.09,-8.94,;17.97,-9.99,;18.33,-11.48,;17.22,-12.56,;15.73,-12.11,;15.38,-10.62,;16.49,-9.56,;9.62,-6.51,;8.29,-5.75,;2.95,-4.23,;1.61,-3.45,;.26,-4.23,;-1.07,-3.46,;-1.07,-1.9,;.26,-1.13,;1.61,-1.9,)|
BDBM50111641 Clc1ccc2sc(=O)n(CC(=O)N3CCC(CC3)C(=O)Nc3cccc(c3)C(=O)c3ccccc3)c2c1
BDBM50111642 COc1ccc(NC(=O)C2CCN(CC2)C(=O)Cn2c3cc(Cl)ccc3sc2=O)cn1
BDBM50111643 OCCc1ccc(NC(=O)C2CCN(CC2)C(=O)Cn2c3cc(Cl)ccc3sc2=O)cc1
BDBM50111644 CC(=O)c1cccc(NC(=O)C2CCN(CC2)C(=O)Cn2c3cc(Cl)ccc3sc2=O)c1
BDBM50111645 Fc1ccc(NC(=O)C2CCN(CC2)C(=O)Cn2c3cc(Cl)ccc3sc2=O)cc1C(F)(F)F
BDBM50111646 Clc1ccc2sc(=O)n(CC(=O)N3CCC(CC3)C(=O)Nc3cccc4ccccc34)c2c1
BDBM50111647 Clc1ccc2sc(=O)n(CC(=O)N3CCC(CC3)C(=O)Nc3ccc(Oc4ccccc4)cc3)c2c1
BDBM50111648 Cc1ccc2nc(NC(=O)C3CCN(CC3)C(=O)Cn3c4cc(Cl)ccc4sc3=O)sc2c1
BDBM50111649 CCCCCCCCCCNC(=O)C1CCN(CC1)C(=O)Cn1c2cc(Cl)ccc2sc1=O
BDBM50111650 OC(CNC(=O)C1CCN(CC1)C(=O)Cn1c2cc(Cl)ccc2sc1=O)c1ccccc1
BDBM50111651 Cc1cc(O)ccc1NC(=O)C1CCN(CC1)C(=O)Cn1c2cc(Cl)ccc2sc1=O
BDBM50111653 NS(=O)(=O)c1ccc(CCNC(=O)C2CCN(CC2)C(=O)Cn2c3cc(Cl)ccc3sc2=O)cc1
BDBM50111654 COc1ccc(CNC(=O)C2CCN(CC2)C(=O)Cn2c3cc(Cl)ccc3sc2=O)cc1
BDBM50111655 Clc1ccc2oc(NC(=O)C3CCN(CC3)C(=O)Cn3c4cc(Cl)ccc4sc3=O)nc2c1
BDBM50145232 Cc1ccc2OCCc3sc(NCC4CCN(CC4)C(=O)[C@H]4CCCO4)nc3-c2c1
BDBM50145236 CCCCC(=O)N1CCC(CNc2nc-3c(CCOc4ccc(F)cc-34)s2)CC1
BDBM50145239 CC(=O)N1CCC(CNc2nc-3c(CCCc4ccc(F)cc-34)s2)CC1
BDBM50145242 CC(C)C(=O)N1CCC(CNc2nc-3c(CCOc4ccc(C)cc-34)s2)CC1