BindingDB logo
myBDB logout

15 SMILES Strings for acyl coA-diacylglycerol acyl transferase 1 (DGAT1)

Compound NameSMILES String
BDBM120758 CC(C)(NC(=O)c1cncs1)C(=O)Nc1nc(c(Oc2ccc(F)cc2)s1)-c1ccc(F)cc1
BDBM120759 O=C(CC1CCCC1)N1CCC[C@H]1C(=O)Nc1cc(-c2ccccc2)c2ccccc2n1
BDBM120760 Cc1ccc(cc1)-c1cc(NC(=O)[C@@H]2CCCN2C(=O)OC(C)(C)C)nc(c1)-c1ccccc1
BDBM120761 CC(C)(NC(=O)C1(C)CC1)C(=O)Nc1nc(c(s1)C(=O)c1ccc(F)cc1)C(F)(F)F
BDBM120762 CC(C)(NC(=O)N1CCCOCC1)C(=O)Nc1nc(c(s1)C(=O)c1ccc(F)cc1)C(F)(F)F
BDBM120763 CC(C)(NC(=O)c1ccccn1)C(=O)Nc1nc(-c2ccc(F)cc2)n(Cc2ccccc2)n1
BDBM120764 CN1CCC[C@H]1C(=O)NC(C)(C)C(=O)Nc1nc(-c2ccc(F)cc2)n(Cc2ccccc2)n1
BDBM120765 CC(C)(NC(=O)c1cnco1)C(=O)Nc1nc(-c2ccc(F)cc2)n(Cc2ccccc2)n1
BDBM120766 Cc1cc(no1)C(=O)NC(C)(C)C(=O)Nc1nc(-c2ccc(F)cc2)n(Cc2ccccc2)n1
BDBM120767 CC(C)(NC(=O)c1ccc(OC(F)(F)F)cc1)C(=O)Nc1nc(c(Oc2ccc(F)cc2)s1)-c1ccc(F)cc1
BDBM120753 CCOc1ccc(cc1OCC)C(=O)NC(C)(C)C(=O)Nc1nc(c(Cc2ccccc2)s1)-c1ccccc1
BDBM120754 CC(C)(NS(=O)(=O)c1ccc(F)cc1)C(=O)Nc1nc(c(Cc2ccccc2)s1)-c1ccccc1
BDBM120755 COc1ccccc1C(=O)NC(C)(C)C(=O)Nc1nc(c(Cc2ccccc2)s1)-c1ccccc1
BDBM120756 CC(C)(NC(=O)c1ccc2occc2c1)C(=O)Nc1nc(c(Cc2ccccc2)s1)-c1ccccc1
BDBM120757 CC(C)(NC(=O)c1ccccn1)C(=O)Nc1nc(c(Cc2ccccc2)s1)-c1ccccc1