BindingDB logo
myBDB logout

77 SMILES Strings for alpha-Glucosidase (alpha-Glu)

Compound NameSMILES String
BDBM18351 OC[C@H]1NC[C@H](O)[C@@H](O)[C@@H]1O
BDBM18353 CN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO
BDBM18354 CCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO
BDBM18355 CCCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO
BDBM18356 CCCCCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO
BDBM18357 CCCCCCCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO
BDBM18358 CCCCCCCCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO
BDBM18359 C[C@H]1N[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
BDBM18360 CCC[C@H]1N[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
BDBM18361 CCCC[C@H]1N[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
BDBM18362 CCCCCC[C@H]1N[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
BDBM18363 CCCCCCCC[C@H]1N[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
BDBM18364 CCCCCCCCC[C@H]1N[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
BDBM18366 OC[C@H]1N[C@H](CO)[C@H](O)C(O)[C@@H]1O
BDBM19992 OC(=O)Cc1cccc(OCCCN(CC(c2ccccc2)c2ccccc2)Cc2cccc(c2Cl)C(F)(F)F)c1
BDBM19993 OC(c1ccc(cc1)N(CC(F)(F)F)S(=O)(=O)c1ccccc1)(C(F)(F)F)C(F)(F)F
BDBM19459 Oc1ccc(cc1)-c1coc2cc(O)cc(O)c2c1=O
BDBM23406 C[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1N[C@H]1C=C(CO)[C@@H](O)[C@H](O)[C@H]1O |t:37|
BDBM23838 [H][C@@]1(CCC2C1[C@H](C)CC1C2CC=C2C[C@@H](O)CC[C@]12C)[C@H](C)[C@H](O)CCC(C)C |r,t:14|
BDBM23839 Oc1ccc-2c(CCc3ccc(Oc4cc(CCc5ccc-2c(O)c5)ccc4O)cc3)c1
BDBM23840 O=C1N(C(=O)c2ccccc12)c1ccccc1CCc1ccccc1
BDBM23841 CCCCCCc1ccccc1N1C(=O)c2ccccc2C1=O
BDBM23842 CC(C)c1cccc(C(C)C)c1N1C(=O)c2ccccc2C1=S
BDBM23843 COc1ccc-2c(CCc3ccc(Oc4cc(CCc5ccc-2c(OC)c5)ccc4OC)cc3)c1
BDBM23844 COc1ccc2CCc3ccc(c(OC)c3)-c3ccccc3CCc3ccc(Oc1c2)cc3
BDBM23845 COc1ccc-2c(CCc3ccc(Oc4cc(CCc5ccc-2cc5)ccc4OC)cc3)c1
BDBM23846 COc1ccc-2c(CCc3ccc(Oc4cccc(CCc5ccc-2c(OC)c5)c4)cc3)c1
BDBM23847 COc1ccc2CCc3ccc(cc3)-c3ccccc3CCc3ccc(Oc1c2)cc3
BDBM23848 COc1cc2CCc3cccc(Oc4ccc(CCc5ccccc5-c1cc2)cc4)c3
BDBM23849 Oc1ccc2CCc3ccc(c(O)c3)-c3ccccc3CCc3ccc(Oc1c2)cc3
BDBM23850 Oc1ccc-2c(CCc3ccc(Oc4cc(CCc5ccc-2cc5)ccc4O)cc3)c1
BDBM23851 Oc1ccc-2c(CCc3ccc(Oc4cccc(CCc5ccc-2c(O)c5)c4)cc3)c1
BDBM23852 Oc1ccc2CCc3ccc(cc3)-c3ccccc3CCc3ccc(Oc1c2)cc3
BDBM23853 Oc1cc2CCc3cccc(Oc4ccc(CCc5ccccc5-c1cc2)cc4)c3
BDBM23854 C1Cc2cccc(Oc3ccc(CCc4ccccc4-c4ccc1cc4)cc3)c2
BDBM50068234 Clc1ccc2NC(=O)C(c2c1)(c1c[nH]c2ccccc12)c1c[nH]c2ccccc12
BDBM222407 OCC1O[C@@H](NC(=O)CCc2cn(nn2)-c2ccc(O)cc2)C(O)C(O)[C@@H]1O |r|
BDBM222408 Cc1ccc(cc1)-n1cc(CCC(=O)N[C@@H]2OC(CO)[C@@H](O)C(O)C2O)nn1 |r|
BDBM222405 OCC1O[C@@H](NC(=O)CCc2cn(nn2)-c2ccccc2)C(O)C(O)[C@@H]1O |r|
BDBM222406 COc1ccc(cc1)-n1cc(CCC(=O)N[C@@H]2OC(CO)[C@@H](O)C(O)C2O)nn1 |r|
BDBM222409 OCC1O[C@@H](NC(=O)CCc2cn(Cc3ccccc3)nn2)C(O)C(O)[C@@H]1O |r|
BDBM222410 OCC1O[C@@H](NC(=O)CCc2cn(nn2)-c2ccc3ccccc3c2)C(O)C(O)[C@@H]1O |r|
BDBM222411 COc1ccc(OC)c(c1)-n1cc(CCC(=O)N[C@@H]2OC(CO)[C@@H](O)C(O)C2O)nn1 |r|
BDBM225288 Clc1ccccc1Cn1cc(c2ccccc12)C1(C(=O)Nc2ccccc12)c1cn(Cc2ccccc2Cl)c2ccccc12
BDBM225289 Fc1ccccc1Cn1cc(c2ccccc12)C1(C(=O)Nc2ccccc12)c1cn(Cc2ccccc2F)c2ccccc12
BDBM225290 CCCn1cc(c2ccccc12)C1(C(=O)Nc2ccccc12)c1cn(CCC)c2ccccc12
BDBM225293 CC(C)Cn1cc(c2ccccc12)C1(C(=O)Nc2ccccc12)c1cn(CC(C)C)c2ccccc12
BDBM222412 COc1cc(cc(OC)c1OC)-n1cc(CCC(=O)N[C@@H]2OC(CO)[C@@H](O)C(O)C2O)nn1 |r|
BDBM225291 CC(C)n1cc(c2ccccc12)C1(C(=O)Nc2ccccc12)c1cn(C(C)C)c2ccccc12
BDBM223118 Brc1ccc(CN2C(=O)\C(=N/NC(=O)COc3ccc4ccc(=O)oc4c3)c3ccccc23)cc1
BDBM223119 Cc1ccc2N(Cc3ccccc3F)C(=O)\C(=N/NC(=O)COc3ccc4ccc(=O)oc4c3)c2c1
BDBM223120 Cc1ccc2N(Cc3cccc(F)c3)C(=O)\C(=N/NC(=O)COc3ccc4ccc(=O)oc4c3)c2c1
BDBM223122 Fc1cccc(CN2C(=O)\C(=N/NC(=O)COc3ccc4ccc(=O)oc4c3)c3cc(Cl)ccc23)c1
BDBM223106 O=C(COc1ccc2ccc(=O)oc2c1)N\N=C1/C(=O)Nc2ccccc12
BDBM223107 Cc1ccc2NC(=O)\C(=N/NC(=O)COc3ccc4ccc(=O)oc4c3)c2c1
BDBM223113 CN1C(=O)\C(=N/NC(=O)COc2ccc3ccc(=O)oc3c2)c2ccccc12
BDBM223125 Brc1ccc(CN2C(=O)\C(=N/NC(=O)COc3ccc4ccc(=O)oc4c3)c3cc(Br)ccc23)cc1
BDBM225292 CCCCn1cc(c2ccccc12)C1(C(=O)Nc2ccccc12)c1cn(CCCC)c2ccccc12
BDBM223109 Fc1ccc2NC(=O)\C(=N/NC(=O)COc3ccc4ccc(=O)oc4c3)c2c1
BDBM223108 Cc1cc2\C(=N\NC(=O)COc3ccc4ccc(=O)oc4c3)C(=O)Nc2c(C)c1
BDBM223110 Clc1ccc2NC(=O)\C(=N/NC(=O)COc3ccc4ccc(=O)oc4c3)c2c1
BDBM223111 Brc1ccc2NC(=O)\C(=N/NC(=O)COc3ccc4ccc(=O)oc4c3)c2c1
BDBM223112 [O-][N+](=O)c1ccc2NC(=O)\C(=N/NC(=O)COc3ccc4ccc(=O)oc4c3)c2c1
BDBM223121 Fc1ccccc1CN1C(=O)\C(=N/NC(=O)COc2ccc3ccc(=O)oc3c2)c2cc(Cl)ccc12
BDBM225281 O=C1Nc2ccccc2C1(c1c[nH]c2ccccc12)c1c[nH]c2ccccc12
BDBM225282 Brc1ccc2NC(=O)C(c2c1)(c1c[nH]c2ccccc12)c1c[nH]c2ccccc12
BDBM225283 Cc1ccc2NC(=O)C(c2c1)(c1c[nH]c2ccccc12)c1c[nH]c2ccccc12
BDBM225284 Cn1cc(c2ccccc12)C1(C(=O)Nc2ccccc12)c1cn(C)c2ccccc12
BDBM223123 Brc1ccc2N(Cc3ccccc3)C(=O)\C(=N/NC(=O)COc3ccc4ccc(=O)oc4c3)c2c1
BDBM223124 Clc1ccccc1CN1C(=O)\C(=N/NC(=O)COc2ccc3ccc(=O)oc3c2)c2cc(Br)ccc12
BDBM223114 O=C(COc1ccc2ccc(=O)oc2c1)N\N=C1/C(=O)N(Cc2ccccc2)c2ccccc12
BDBM223115 Fc1ccccc1CN1C(=O)\C(=N/NC(=O)COc2ccc3ccc(=O)oc3c2)c2ccccc12
BDBM223116 Fc1cccc(CN2C(=O)\C(=N/NC(=O)COc3ccc4ccc(=O)oc4c3)c3ccccc23)c1
BDBM223117 Clc1ccccc1CN1C(=O)\C(=N/NC(=O)COc2ccc3ccc(=O)oc3c2)c2ccccc12
BDBM225285 O=C1Nc2ccccc2C1(c1cn(Cc2ccccc2)c2ccccc12)c1cn(Cc2ccccc2)c2ccccc12
BDBM225286 Fc1cccc(Cn2cc(c3ccccc23)C2(C(=O)Nc3ccccc23)c2cn(Cc3cccc(F)c3)c3ccccc23)c1
BDBM225287 Brc1ccc(Cn2cc(c3ccccc23)C2(C(=O)Nc3ccccc23)c2cn(Cc3ccc(Br)cc3)c3ccccc23)cc1