BindingDB logo
myBDB logout

27 SMILES Strings for alternatively spliced Trp4

Compound NameSMILES String
BDBM72595 COc1ccc2c(C)cc(nc2c1)N1CCCCCC1
BDBM77616 NC(=NC1CCCCC1)c1ccc(Cl)cc1 |w:2.2|
BDBM77617 Cc1cc(nc2ccccc12)N1CCCCC1
BDBM77618 CC1CCN(CC1)c1cc(C)c2ccccc2n1
BDBM77619 Cc1cc(nc2ccccc12)N1CCOCC1
BDBM77620 Cc1cc(nc2ccccc12)N1CCCC1
BDBM77621 C[C@H]1CCCN1c1cc(C)c2ccccc2n1
BDBM77622 Cc1cc(nc2ccccc12)N1CCN(CC1)c1ccncc1
BDBM77623 Cc1ccc2nc(cc(C)c2c1)N1CCCCC1
BDBM77624 Cc1ccc2nc(cc(C)c2c1)N1CCCC1
BDBM77625 CCc1ccc2nc(cc(C)c2c1)N1CCCC1
BDBM77626 Cc1cc(nc2ccc(F)cc12)N1CCCCC1
BDBM77614 Cn1c(NCc2ccc(F)cc2)ncc1-c1ccc(F)cc1
BDBM77615 O=C(Cc1ccccc1)Nc1ccccc1Sc1ccccc1
BDBM79619 COc1ccccc1N1CCN(CC1)c1cc(C)c2ccccc2n1
BDBM79620 Cc1cc(nc2ccccc12)N1CCN(CC1)c1ccccc1C#N
BDBM79621 Cc1cc(nc2ccccc12)N1CCOc2ccccc12
BDBM79617 CC1CC(C)CN(C1)c1cc(C)c2ccccc2n1
BDBM79618 CCN(CC)c1cc(C)c2ccccc2n1
BDBM79622 Cc1cc(nc2ccccc12)N1CCCC(O)C1
BDBM79623 CCc1ccc2nc(cc(C)c2c1)N1CCCCC1
BDBM79624 Cc1cc(nc2ccc(F)cc12)N1CCCC1
BDBM79625 Cc1cccc2c(C)cc(nc12)N1CCCC1
BDBM79626 Cc1ccc2nc(cc(C)c2c1)N1CCCCCC1
BDBM79627 CCc1ccc2nc(cc(C)c2c1)N1CCCCCC1
BDBM79628 Cc1cc(nc2ccccc12)N1CCCCCC1
BDBM79629 Cc1cc(nc2ccc(F)cc12)N1CCCCCC1