BindingDB logo
myBDB logout

1 SMILES String for atrial natriuretic peptide, ANP

Compound NameSMILES String
BDBM86694 ONC=Nc1ccc(N2CCOCC2)c(Cl)c1 |w:3.3|