BindingDB logo
myBDB logout

26 SMILES Strings for b-raf

Compound NameSMILES String
BDBM197677 CCCS(=O)(=O)Nc1ccc(F)c(Nc2ncccc2-c2ncnc3[nH]cnc23)c1F
BDBM197689 Fc1ccc(NS(=O)(=O)c2ccsc2)c(F)c1Nc1ncccc1-c1ncnc2[nH]cnc12
BDBM197706 Fc1ccc(NS(=O)(=O)c2ccccc2)c(F)c1Nc1ncccc1-c1ncnc2[nH]cnc12
BDBM50165871 CS(=O)(=O)Nc1ccc(F)c(Nc2ncccc2-c2ncnc3[nH]cnc23)c1F
BDBM50165873 Fc1ccc(NS(=O)(=O)CC(F)(F)F)c(F)c1Nc1ncccc1-c1ncnc2[nH]cnc12
BDBM50165865 Fc1ccc(cc1)S(=O)(=O)Nc1ccc(F)c(Nc2ncccc2-c2ncnc3[nH]cnc23)c1F
BDBM205042 CCCS(=O)(=O)Nc1ccc(F)c(Nc2ccccc2-c2ncnc3[nH]cnc23)c1F
BDBM205005 CCCS(=O)(=O)Nc1ccc(F)c(Nc2ncccc2-c2ncnc3[nH]c(C)nc23)c1F
BDBM205007 CCCS(=O)(=O)Nc1ccc(F)c(Nc2ncccc2-c2ncnc3[nH]cnc23)c1
BDBM205008 CCCS(=O)(=O)Nc1ccc(Cl)c(Nc2ncccc2-c2ncnc3[nH]cnc23)c1
BDBM205009 CCCS(=O)(=O)Nc1ccc(C)c(Nc2ncccc2-c2ncnc3[nH]cnc23)c1
BDBM205010 CCCS(=O)(=O)Nc1ccc(Cl)c(Nc2ncccc2-c2ncnc3[nH]cnc23)c1F
BDBM205011 CCCS(=O)(=O)Nc1ccc(F)c(Nc2ncccc2-c2ncnc3[nH]cnc23)c1Cl
BDBM205012 FCCCS(=O)(=O)Nc1ccc(Cl)c(Nc2ncccc2-c2ncnc3[nH]cnc23)c1F
BDBM205013 FCCCS(=O)(=O)Nc1ccc(F)c(Nc2ncccc2-c2ncnc3[nH]cnc23)c1F
BDBM205014 Fc1ccc(NS(=O)(=O)CCl)c(F)c1Nc1ncccc1-c1ncnc2[nH]cnc12
BDBM205015 CCS(=O)(=O)Nc1ccc(F)c(Nc2ncccc2-c2ncnc3[nH]cnc23)c1F
BDBM205017 Fc1ccc(cc1F)S(=O)(=O)Nc1ccc(F)c(Nc2ncccc2-c2ncnc3[nH]cnc23)c1F
BDBM205020 Fc1ccc(NS(=O)(=O)c2ccc(Cl)cc2)c(F)c1Nc1ncccc1-c1ncnc2[nH]cnc12
BDBM205021 Fc1ccc(NS(=O)(=O)CCC(F)(F)F)c(F)c1Nc1ncccc1-c1ncnc2[nH]cnc12
BDBM205023 Fc1ccc(NS(=O)(=O)C=C)c(F)c1Nc1ncccc1-c1ncnc2[nH]cnc12
BDBM205024 Fc1ccc(NS(=O)(=O)C2CC2c2ccccc2)c(F)c1Nc1ncccc1-c1ncnc2[nH]cnc12
BDBM205025 COc1ccc(cc1)C1CC1S(=O)(=O)Nc1ccc(F)c(Nc2ncccc2-c2ncnc3[nH]cnc23)c1F
BDBM205035 CCCS(=O)(=O)Nc1ccc(F)c(Nc2ncccc2-c2ncnc3[nH]ncc23)c1F
BDBM205038 CCCS(=O)(=O)Nc1ccc(F)c(Nc2ncccc2-c2ncnc3[nH]ccc23)c1F
BDBM205040 CCCS(=O)(=O)Nc1ccc(C)c(Nc2ccccc2-c2ncnc3[nH]cnc23)c1