BindingDB logo
myBDB logout

6 SMILES Strings for beta-Galactosidase (β-Gal)

Compound NameSMILES String
BDBM50163440 OC[C@H]1NC[C@H](O)[C@@H](O)[C@H]1O |r|
BDBM228802 CCCC\N=C1/SC[C@@H]2[C@H](O)[C@H](O)[C@@H](O)CN12
BDBM228803 CCCC\N=C1\SCC2[C@H](O)[C@H](O)C(O)[C@@H](O)N12 |r|
BDBM228804 CCCCNC(=S)N1CC(O)[C@@H](O)[C@@H](O)C1CO |r|
BDBM228805 OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@H]1O
BDBM228800 CCCCCCCCN[C@H]1C=C(CO)[C@@H](O)[C@H](O)[C@H]1O |t:10|