BindingDB logo
myBDB logout

7 SMILES Strings for beta-Galactosidase (β-gal)

Compound NameSMILES String
BDBM50182795 CN(C)c1cccc2c(cccc12)S(=O)(=O)NCCCCCCN1C[C@H](O)[C@@H](O)[C@@H](O)[C@H]1CO
BDBM50356096 CN(C)c1cccc2c(cccc12)S(=O)(=O)NCCCCCCNC(=O)CCCCCN1C[C@H](O)[C@@H](O)[C@@H](O)[C@H]1CO |r|
BDBM50375511 OC[C@@H]1NC[C@H](O)[C@H]1O
BDBM192767 OC[C@H]1O[C@@H](SCCOC(=O)c2ccc(cc2C(c2ccccc2)c2ccccc2)C(=O)NCCOCCOCCOCCNC(=O)c2ccc(cc2)C(=O)c2ccccc2)[C@H](O)[C@@H](O)[C@H]1O |r|
BDBM192768 OC[C@H]1O[C@@H](SCCOCCOC(=O)c2ccc(cc2C(c2ccccc2)c2ccccc2)C(=O)NCCOCCOCCOCCNC(=O)c2ccc(cc2)C(=O)c2ccccc2)[C@H](O)[C@@H](O)[C@H]1O |r|
BDBM192769 OC[C@H]1O[C@@H](SCCOCCOCCOCCOC(=O)c2ccc(cc2C(c2ccccc2)c2ccccc2)C(=O)NCCOCCOCCOCCNC(=O)c2ccc(cc2)C(=O)c2ccccc2)[C@H](O)[C@@H](O)[C@H]1O |r|
BDBM192770 CC(C)S[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O