BindingDB logo
myBDB logout

4 SMILES Strings for beta-Hydroxyacyl-acyl carrier protein dehydratase (FtFabZ)

Compound NameSMILES String
BDBM11318 Cc1cc(O)c2C(=O)c3c(O)cc(O)cc3C(=O)c2c1
BDBM24777 Oc1cccc2C(=O)C=CC(=O)c12 |c:8|
BDBM50056922 COc1cc(C)c2c(Oc3c4C(O)OC(=O)c4c(O)c(C)c3OC2=O)c1C=O
BDBM50214969 [#6]-[#8]-c1c(-[#8])cc2oc3cc(-[#8])c(-[#6]\[#6]=[#6](\[#6])-[#6])c(-[#8])c3c(=O)c2c1-[#6]\[#6]=[#6](\[#6])-[#6]