BindingDB logo
myBDB logout

22 SMILES Strings for jmjd2a

Compound NameSMILES String
BDBM264032 OC(=O)c1ccnc(c1)-n1nccc1OCc1ccc(Cl)cc1OCc1ccc(F)cc1
BDBM264033 OC(=O)c1ccnc(c1)-n1nccc1OCc1ccc(F)cc1OCc1ccc(F)cc1
BDBM263944 OC(=O)c1ccnc(c1)-n1nccc1-c1ccc(F)cc1F
BDBM263949 OC(=O)c1ccnc(c1)-n1nccc1-c1cccc(O)c1
BDBM263970 OC(=O)c1ccnc(c1)-n1ccc(CCc2ccccc2)n1
BDBM263974 OC(=O)c1ccnc(c1)-n1nccc1OCc1ccccc1
BDBM264026 CCCCOc1cc(Cl)ccc1COc1ccnn1-c1cc(ccn1)C(O)=O
BDBM264027 CC(C)COc1cc(Cl)ccc1COc1ccnn1-c1cc(ccn1)C(O)=O
BDBM263932 OC(=O)c1ccnc(c1)-n1nc(cc1O)C1CC1
BDBM263942 Cc1ccc(cc1)-c1ccnn1-c1cc(ccn1)C(O)=O
BDBM264045 Cc1ccc(COc2ccnn2-c2cc(ccn2)C(O)=O)c(Cl)c1
BDBM264047 Cc1ccc(COc2ccnn2-c2cc(ccn2)C(O)=O)c(C)c1
BDBM264048 COc1cc(C)ccc1COc1ccnn1-c1cc(ccn1)C(O)=O
BDBM264055 OC(=O)c1ccnc(c1)-n1nccc1OCc1ccc(Cl)c(OCC2CC2)c1
BDBM264073 OC(=O)c1ccnc(c1)-n1nc(cc1O)-c1ccc(Cl)cc1
BDBM264074 OC(=O)c1ccnc(c1)-n1nc(cc1O)-c1cccc(Cl)c1
BDBM264075 OC(=O)c1ccnc(c1)-n1nc(cc1O)C1CCCC1
BDBM264077 CC(c1cc(O)n(n1)-c1cc(ccn1)C(O)=O)c1ccccc1
BDBM264078 OC(=O)c1ccnc(c1)-n1nc(Cc2ccccc2Cl)cc1O
BDBM264079 OC(=O)c1ccnc(c1)-n1nc(Cc2cccc(Cl)c2)cc1O
BDBM264080 OC(=O)c1ccnc(c1)-n1nc(Cc2ccc(Cl)cc2)cc1O
BDBM264083 Oc1cc(Cc2cccc(Cl)c2)nn1-c1cc(ccn1)-c1nn[nH]n1