BindingDB logo
myBDB logout

1 SMILES String for kinesin spindle protein Mutant (A356T)

Compound NameSMILES String
BDBM36350 FC(F)(F)c1ccc(cc1)-c1ccc2NC(=O)CCc2c1