BindingDB logo
myBDB logout

3 SMILES Strings for kinesin spindle protein Mutant (D130V)

Compound NameSMILES String
BDBM36350 FC(F)(F)c1ccc(cc1)-c1ccc2NC(=O)CCc2c1
BDBM36351 [H][C@]12[C@H](OC(=O)c3ccccc3)[C@]3(O)C[C@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)c4ccccc4)C(C)=C([C@@H](O)C(=O)[C@]1(C)[C@@H](O)C[C@H]1OC[C@@]21OC(C)=O)C3(C)C |t:39|
BDBM50220156 CC(C)[C@@H](N(CCCN)C(=O)c1ccc(C)c(F)c1)c1nc2cc(Cl)ccc2c(=O)n1Cc1ccccc1