BindingDB logo
myBDB logout

19 SMILES Strings for likely tRNA 2'-phosphotransferase

Compound NameSMILES String
BDBM4078 Oc1cc2c3c(oc(=O)c4cc(O)c(O)c(oc2=O)c34)c1O
BDBM46229 NS(=O)(=O)c1cc(ccc1Cl)C(=O)NC1CCSc2ccccc12
BDBM44482 CC(C)C(N1C(=S)S\C(=C/C=C/c2ccco2)C1=O)C(O)=O
BDBM46749 [#6]-[#6](=O)-[#7]-1-[#6](=O)\[#6](-c2ccccc-12)=[#6]-1\[#6]=[#6](-[#6])-[#8]-[#6](-[#6])=[#6]-1 |c:21,t:16|
BDBM50648 O=C(NN1C(=S)S\C(=C/C=C/c2ccco2)C1=O)c1ccncc1
BDBM50729 O=C1N(NS(=O)(=O)c2ccccc2)C(=S)S\C1=C/C=C/c1ccco1
BDBM52921 CCOc1cc(\C=C2/C(=O)NC(=O)N(CCc3ccc(F)cc3)C2=O)ccc1O
BDBM51782 Cc1ccccc1N1C(=S)NC(=O)C(=Cc2ccco2)C1=O |w:14.15|
BDBM51785 COc1ccc(OC)c(c1)N1C(=S)NC(=O)C(=Cc2ccco2)C1=O |w:17.18|
BDBM51791 Cc1cc(C)n(Cc2ccc(o2)C(=O)N\N=C\c2ccc(o2)-c2ccc(cc2)[N+]([O-])=O)n1
BDBM54791 COc1ccc(Cl)cc1C(=O)Nc1cccc(c1)-c1ccc2nncn2n1
BDBM54758 CC1=C(C#N)C(=O)N(C2CCS(=O)(=O)C2)C(=O)\C1=C/c1ccco1 |c:1|
BDBM55008 NC(=O)c1cc[n+](CC2=C(N3[C@H](SC2)[C@H](NC(=O)C(c2ccccc2)S([O-])(=O)=O)C3=O)C([O-])=O)cc1 |t:8|
BDBM55009 Cc1ccc2nc(N=NCc3ccc(o3)[N+]([O-])=O)nc(-c3ccccc3)c2c1 |w:7.6|
BDBM55010 Cn1cc(ccc1=O)C(=O)NN=Cc1c(O)ccc2ccccc12 |w:11.11|
BDBM55011 Cc1ccc(cc1)-n1c(=O)[nH]c([O-])c([CH+]c2ccc(o2)[N+]([O-])=O)c1=O
BDBM55012 Cc1ccc(OCCn2cccc2\C=C2\C(=O)NC(=O)N(Cc3ccco3)C2=O)cc1
BDBM55013 COc1cc(\C=C2/SC(=O)N(CC(=O)Nc3ccccc3F)C2=O)cc(Cl)c1O
BDBM55014 CCN1CCN(CC1)c1cc(N2CCN(CC2)C(=O)c2ccco2)c2C(=O)c3ccccc3-c3onc1c23