BindingDB logo
myBDB logout

2 SMILES Strings for mTOR/ DNA-PK

Compound NameSMILES String
BDBM36409 CC(C)n1nc(-c2cc3cc(O)ccc3[nH]2)c2c(N)ncnc12
BDBM36410 Nc1ncnc2n(nc(-c3ccn4ccnc4c3)c12)C1CCCC1