BindingDB logo
myBDB logout

1 SMILES String for mTOR/ Src

Compound NameSMILES String
BDBM36409 CC(C)n1nc(-c2cc3cc(O)ccc3[nH]2)c2c(N)ncnc12