BindingDB logo
myBDB logout

5 SMILES Strings for metabotropic glutamate 5a

Compound NameSMILES String
BDBM17660 N[C@@H](Cn1oc(=O)[nH]c1=O)C(O)=O
BDBM17657 N[C@@H](CCC(O)=O)C(O)=O
BDBM82355 NC(C(O)=O)c1cc(=O)[nH]o1
BDBM50004863 N[C@]1(CC[C@@H](C1)C(O)=O)C(O)=O
BDBM50060133 N[C@@]1(CC[C@H](C1)C(O)=O)C(O)=O