BindingDB logo
myBDB logout

31 SMILES Strings for mineralocorticoid

Compound NameSMILES String
BDBM19191 [H][C@@]1(CCCC2=Cc3c(C[C@]12C)cnn3-c1ccc(F)cc1)[C@@H](O)c1ccccc1 |r,t:5|
BDBM19192 [H][C@@]1(CCCC2=Cc3c(C[C@]12C)cnn3-c1ccc(F)cc1)[C@@H](O)c1ccc(F)cc1 |r,t:5|
BDBM19199 [H][C@@]1(CCCC2=Cc3c(C[C@]12C)cnn3-c1ccc(F)cc1)[C@@H](O)c1cc(F)c(F)c(OC)c1 |r,t:5|
BDBM19200 [H][C@@]1(CCCC2=Cc3c(C[C@]12C)cnn3-c1ccc(F)cc1)[C@H](O)c1ccc(F)cc1 |r,t:5|
BDBM19201 [H][C@@]1(CCCC2=Cc3c(C[C@]12C)cnn3-c1ccc(F)cc1)[C@](C)(O)c1ccc(F)cc1 |r,t:5|
BDBM19207 [H][C@@]1(CCCC2=Cc3c(C[C@]12C)cnn3-c1ccc(F)cc1)[C@@H](O)CCC=C |r,t:5|
BDBM19214 [H][C@@]12CC[C@H](C(=O)CO)[C@]1(C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C)C=O |t:21|
BDBM18525 CC(O)(CS(=O)(=O)c1ccc(F)cc1)C(=O)Nc1ccc(C#N)c(c1)C(F)(F)F
BDBM18161 [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@@]2([H])CC(=O)CC[C@]12C |r|
BDBM86689 CC#CC1(O)CCC2C3CCC4=CC(=O)CCC4=C3C(CC12C)c1ccc(cc1)N(C)C |c:18,t:11|
BDBM86690 CC#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@H](C[C@]12C)c1ccc(cc1)N(C)CCO[C@H]1CCC2C(C1)C[C@@H](O)C1C3CCC(C(C)CCC(O)=O)C3[C@@H](O)CC21 |r,c:18,t:11|
BDBM50004519 CC1(C)Oc2cc(NS(C)(=O)=O)ccc2N(C1=O)c1ccc(F)cc1
BDBM50167794 C[C@]12Cc3cnn(c3C=C1CCC21OCCO1)-c1ccc(F)cc1 |c:9|
BDBM50167795 C[C@H]1OC2(CCC3=Cc4c(C[C@]23C)cnn4-c2ccc(F)cc2)O[C@@H]1C |t:6|
BDBM50167796 C[C@]12Cc3cnn(c3C=C1CCC21O[C@H](C=C)[C@H](O1)C=C)-c1ccc(F)cc1 |c:9|
BDBM50167799 C[C@]12Cc3cnn(c3C=C1CCCC21O[C@H](C=C)[C@H](O1)C=C)-c1ccc(F)cc1 |c:9|
BDBM50167808 C[C@]12Cc3cnn(c3C=C1CCCC21OCCO1)-c1ccc(F)cc1 |c:9|
BDBM50167790 C[C@H]1C[C@H](C)O[C@@]2(CCC3=Cc4c(C[C@]23C)cnn4-c2ccc(F)cc2)O1 |t:9|
BDBM50338693 CC(C)(CO)[C@H]1Nc2ccc(cc2[C@H]2C=CC[C@@H]12)[N+]([O-])=O |r,c:15|
BDBM50336280 C[C@@H]1CCCCCCCc2cc(O)cc(O)c2C(=O)O1 |r|
BDBM50336274 CC(=O)Oc1cc2CCCCCCCCCCOC(=O)c2c(OC(C)=O)c1
BDBM50336275 CC(=O)Oc1cc2CCCCCCCOC(=O)c2c(OC(C)=O)c1
BDBM50336276 CC(=O)Oc1cc2CCCCCCCCCOC(=O)c2c(OC(C)=O)c1
BDBM50336277 CC(=O)Oc1cc2CCCCCCCCOC(=O)c2c(OC(C)=O)c1
BDBM50336278 C[C@@H]1CCCCCCCc2cc(OC(C)=O)cc(OC(C)=O)c2C(=O)O1 |r|
BDBM50336279 C[C@@H]1CCCCCCCc2cc(OS(=O)(=O)c3ccc(C)cc3)cc(OS(=O)(=O)c3ccc(C)cc3)c2C(=O)O1 |r|
BDBM50336281 COc1cc2CC\C=C/CCC[C@@H](C)OC(=O)c2c(OC)c1 |r,c:7|
BDBM50336282 CCC(=O)Oc1cc2CCCCCCC[C@@H](C)OC(=O)c2c(OC(=O)CC)c1 |r|
BDBM50355936 CN(C)[C@H]1C[C@H](Nc2ccc(cc12)[N+]([O-])=O)C(C)(C)CO |r|
BDBM50398060 COc1cc(ccc1S(N)(=O)=O)C(=O)Nc1ccc(c(CCN(C)C2CC2)c1)-c1ccccc1OC(F)(F)F
BDBM50398062 CC1(C)OC(=S)Nc2ccc(NS(=O)(=O)c3cccs3)cc12