BindingDB logo
myBDB logout

5 SMILES Strings for modified VEGFR3 cytoplasmic domain

Compound NameSMILES String
BDBM176587 COc1cc(ccc1Nc1ncc(c(CCc2ccccc2CC(N)=O)n1)C(F)(F)F)N1CCNCC1
BDBM176588 COc1cc(ccc1Nc1ncc(c(CCc2ccccc2CC(N)=O)n1)C(F)(F)F)C1CCNCC1
BDBM176591 COc1cc(ccc1Nc1ncc(c(CCc2cccc(c2)C(N)=O)n1)C(F)(F)F)C1CCNCC1
BDBM176593 CCN1CCC(CC1)c1ccc(Nc2ncc(c(Cc3ccccc3C(N)=O)n2)C(F)(F)F)c(OC)c1
BDBM176598 CN1CCC(CC1)c1ccc(Nc2ncc(c(CCc3ccccc3CC(N)=O)n2)C(F)(F)F)c(C)c1