BindingDB logo
myBDB logout

16 SMILES Strings for nAChR alpha4 beta2 subtype

Compound NameSMILES String
BDBM50004108 CN1CCCC1c1cccnc1
BDBM50143320 Clc1ccc(cn1)[C@@H]1C[C@H]2CC[C@@H]1N2 |THB:4:7:13:11.10|
BDBM221048 C1[C@H]2CNC[C@@H]1c1cc3nccnc3cc21
BDBM221049 Clc1ncc(cc1-c1cncnc1)C1CC2CCC1N2 |THB:4:13:16.17:19|
BDBM221036 Fc1ccc(cn1)-c1cc(cnc1F)C1CC2CCC1N2 |THB:9:14:17.18:20|
BDBM221037 Fc1ncc(cc1-c1ccc(Cl)nc1)C1CC2CCC1N2 |THB:4:14:17.18:20|
BDBM221035 Fc1ncc(cc1-c1cccnc1)C1CC2CCC1N2 |THB:4:13:16.17:19|
BDBM221038 Nc1ccc(cn1)-c1cc(cnc1F)C1CC2CCC1N2 |THB:9:14:17.18:20|
BDBM221039 COc1ccc(cn1)-c1cc(cnc1F)C1CC2CCC1N2 |THB:10:15:18.19:21|
BDBM221040 Fc1ncc(cc1-c1ccncc1)C1CC2CCC1N2 |THB:4:13:16.17:19|
BDBM221041 Fc1cc(ccn1)-c1cc(cnc1F)C1CC2CCC1N2 |THB:9:14:17.18:20|
BDBM221042 Fc1ncc(cc1-c1ccnc(Cl)c1)C1CC2CCC1N2 |THB:4:14:17.18:20|
BDBM221043 Nc1cc(ccn1)-c1cc(cnc1F)C1CC2CCC1N2 |THB:9:14:17.18:20|
BDBM221045 C1CC2NC1CC2c1cncc(c1)-c1cncnc1 |THB:7:6:0.1:3|
BDBM221046 Fc1ncc(cc1-c1cncnc1)C1CC2CCC1N2 |THB:4:13:16.17:19|
BDBM221044 COc1cc(ccn1)-c1cc(cnc1F)C1CC2CCC1N2 |THB:10:15:18.19:21|