Retinoic acid receptor gamma
Meas. Tech.
12±n/a nM
 Jong, LLehmann, JMHobbs, PDHarlev, EHuffman, JCPfahl, MDawson, MI Conformational effects on retinoid receptor selectivity. 1. Effect of 9-double bond geometry on retinoid X receptor activity. J Med Chem 36:2605-13 (1993) [PubMed]  Article
Retinoic acid receptor gamma
Nuclear receptor subfamily 1 group B member 3 | RAR-gamma | Retinoic acid receptor RXR-alpha/gamma | Retinoic acid receptor gamma | Retinoid receptor
Mol. Mass.:
Homo sapiens (Human)
9-cis retinoic acid | 9C-RA | CHEMBL705 | Panretin | alitretinoin
Small organic molecule
Emp. Form.:
Mol. Mass.:
C\C(\C=C\C1=C(C)CCCC1(C)C)=C\C=C\C(\C)=C\C(O)=O |c:4|
Search PDB for entries with ligand similarity: