Retinoic acid receptor gamma
Meas. Tech.
148±n/a nM
 Vuligonda, VGarst, MEChandraratna, RA Stereoselective synthesis and receptor activity of conformationally defined retinoid X receptor selective ligands. Bioorg Med Chem Lett 9:589-94 (1999) [PubMed]  Article
Retinoic acid receptor gamma
Nuclear receptor subfamily 1 group B member 3 | RAR-gamma | Retinoic acid receptor RXR-alpha/gamma | Retinoic acid receptor gamma | Retinoid receptor
Mol. Mass.:
Homo sapiens (Human)
9-cis retinoic acid | 9C-RA | CHEMBL705 | Panretin | alitretinoin
Small organic molecule
Emp. Form.:
Mol. Mass.:
C\C(\C=C\C1=C(C)CCCC1(C)C)=C\C=C\C(\C)=C\C(O)=O |c:4|
Search PDB for entries with ligand similarity: