Ki Summary BindingDB logo
myBDB logout
Reaction Details
Report a problem with these data
Target10 kDa chaperonin
Meas. Tech.ChEMBL_1891108
IC50 2100±n/a nM
Citation Stevens, MAbdeen, SSalim, NRay, AMWashburn, AChitre, SSivinski, JPark, YHoang, QQChapman, EJohnson, SM HSP60/10 chaperonin systems are inhibited by a variety of approved drugs, natural products, and known bioactive molecules. Bioorg Med Chem Lett29:1106-1112 (2019) [PubMed]  Article
More Info.:Get all data from this article,  Assay Method
10 kDa chaperonin
Name:10 kDa chaperonin
Synonyms:10 kDa chaperonin | A6592_09565 | A8C65_01575 | A8G17_01630 | A8M42_07845 | A9819_23720 | A9R57_13540 | AA102_13090 | AC067_05500 | AC789_1c45560 | ACN002_4371 | ACN77_13920 | ACN81_06320 | ACU57_19300 | ACU90_27615 | AJ318_17200 | AKG99_18190 | AM266_00720 | AM270_14495 | AM446_25375 | AM464_15775 | AM465_02155 | AMK83_27455 | AML07_06095 | AML35_20700 | APT13_02990 | APT94_02240 | APU18_25330 | APZ14_01130 | ARC77_17985 | AU473_28150 | AUQ13_10295 | AUS26_18730 | AW059_20460 | AW106_26295 | AWE53_002050 | AWF59_005880 | AWG78_009870 | AWP75_27435 | AXA56_02185 | AZE01_18035 | AZE03_09985 | AZZ83_002780 | B1K96_03095 | B7C53_14120 | B9M99_07790 | B9N28_21675 | B9N33_15910 | B9T59_10255 | BANRA_00107 | BANRA_00146 | BANRA_02788 | BANRA_02829 | BB545_11045 | BE963_12225 | BEN53_00760 | BER14_11405 | BET08_18555 | BFD68_08445 | BH694_19645 | BHF46_15620 | BHS81_24825 | BHS87_23220 | BIQ87_23890 | BIU72_06100 | BIZ41_02705 | BJJ90_23455 | BK248_23635 | BK292_23450 | BK334_08300 | BK373_03445 | BK375_06860 | BK383_12935 | BK400_02725 | BMR23_13235 | BMT49_19175 | BMT53_11940 | BMT91_05490 | BN17_41221 | BON63_07070 | BON66_25755 | BON69_04685 | BON76_04280 | BON81_15960 | BON92_18270 | BON93_15340 | BON96_03710 | BSR05_14025 | BTQ04_18130 | BTQ06_07130 | BUE81_24320 | BVL39_04420 | BW690_22400 | BWP17_13610 | BXT93_23585 | BZL31_12945 | BZL69_06915 | BvCms12BK_04200 | BvCms2454_04386 | BvCms35BK_01934 | BvCmsA75A_02317 | BvCmsC61A_01712 | BvCmsF63A_01378 | BvCmsH15A_02827 | BvCmsHHP001_00680 | BvCmsHHP019_00805 | BvCmsHHP056_01306 | BvCmsJ76A_03970 | BvCmsKKP036_00133 | BvCmsKKP061_03323 | BvCmsKSNP019_03304 | BvCmsKSNP073_03446 | BvCmsKSNP081_01938 | BvCmsKSNP120_00881 | BvCmsKSP008_05436 | BvCmsKSP011_04702 | BvCmsKSP015_03625 | BvCmsKSP018_00065 | BvCmsKSP024_01293 | BvCmsKSP026_01574 | BvCmsKSP036_01507 | BvCmsKSP039_04908 | BvCmsKSP040_00954 | BvCmsKSP045_02509 | BvCmsKSP054_04831 | BvCmsKSP058_02606 | BvCmsKSP061_02113 | BvCmsKSP067_03876 | BvCmsKSP076_00896 | BvCmsKSP081_03342 | BvCmsKSP083_02936 | BvCmsNSNP006_03058 | BvCmsNSNP023_02527 | BvCmsNSNP027_02999 | BvCmsNSNP036_02364 | BvCmsNSP006_05621 | BvCmsNSP007_04897 | BvCmsNSP039_02860 | BvCmsNSP045_04078 | BvCmsNSP047_02053 | BvCmsNSP052_03162 | BvCmsNSP072_00462 | BvCmsNSP078_00003 | BvCmsOUP014_01584 | BvCmsSINP011_01478 | BvCmsSINP022_02411 | BvCmsSINP036_01421 | BvCmsSIP006_02881 | BvCmsSIP010_01339 | BvCmsSIP019_03073 | BvCmsSIP044_04390 | C1I39_24095 | C1I57_02520 | C1N95_001425 | C2858_12000 | C2M16_07140 | C2U48_11805 | C3449_11490 | C3B70_03750 | C3K24_17535 | C4J69_05790 | C4J69_17885 | C4K41_15735 | C4M78_05805 | C5715_24365 | C5N07_07005 | C5P01_11480 | C5P43_04985 | C5P44_18545 | C5P48_04555 | C6669_06705 | C6976_23910 | C6986_26905 | C6A57_08335 | C6B13_11450 | C7235_22805 | C7B02_22875 | C7B06_19625 | C7B07_19645 | C7B08_13325 | C7B18_22130 | C7R96_25140 | C9025_24795 | C9083_18255 | C9200_11075 | C9212_22300 | C9255_05365 | C9299_14025 | C9E25_08285 | C9E67_27740 | C9Y80_28145 | C9Y95_08225 | C9Z12_10190 | CA593_05110 | CCZ08_19870 | CCZ11_19945 | CCZ14_19965 | CCZ16_17420 | CCZ17_16285 | CCZ18_09565 | CDL37_19960 | CG691_04050 | CG692_00050 | CG705_07480 | CG706_19955 | CI641_014240 | CI694_17135 | CIJ94_19310 | CLH66_25390 | COD30_28665 | COD46_17605 | CPA47_23810 | CQP61_24790 | CR538_23265 | CR539_02655 | CRD98_26735 | CRE06_15180 | CRM83_17510 | CRT43_24980 | CRT46_24620 | CRT55_26570 | CSB64_20585 | CT143_14480 | CT146_11190 | CU078_13315 | CUB99_10690 | CV83915_01889 | CVH05_06680 | CWM24_06440 | CWS33_03385 | CXB56_25450 | CY655_26165 | D0X26_12775 | D1900_07560 | D1912_29305 | D2183_06175 | D2184_07880 | D2185_07630 | D2F89_07875 | D3821_07225 | D3822_10755 | D3C88_27265 | D3I61_24430 | D3O91_01395 | D3Y67_00550 | D4M06_10265 | D4M06_29415 | D7K63_02300 | D7K66_01650 | D7Y10_20705 | D9D20_08435 | D9D31_08055 | D9D33_02515 | D9D43_14730 | D9E34_15020 | D9E35_09920 | D9E49_11980 | D9G11_15845 | D9G42_15390 | D9G48_11765 | D9H53_05450 | D9H68_15860 | D9H70_08855 | D9H94_06460 | D9I11_08165 | D9I18_04545 | D9I20_17830 | D9I87_11055 | D9I88_12300 | D9I97_14785 | D9J03_08610 | D9J11_13650 | D9J44_18170 | D9J46_16920 | D9J60_12280 | D9K48_05195 | D9K54_26345 | D9L89_02295 | D9L89_29685 | D9L99_20605 | D9N32_18885 | D9X97_13610 | D9X97_28715 | DAH26_05040 | DAH27_28005 | DAH36_09870 | DAH37_06375 | DD647_07900 | DD762_21025 | DDT63_05220 | DEN86_00715 | DEN89_17485 | DEO11_24175 | DEO19_26320 | DIV10_26325 | DIV20_20405 | DIV22_13640 | DIV24_06075 | DIV25_24085 | DK267_13565 | DK268_16990 | DK273_16830 | DK278_16490 | DK279_16715 | DK288_16410 | DK289_16805 | DKP82_04070 | DKP83_02485 | DKP87_04525 | DKP89_17865 | DL195_09035 | DL455_10650 | DL545_22735 | DL800_29225 | DM102_08865 | DM463_13475 | DMI04_11455 | DMI04_28180 | DNB37_06990 | DNB37_28245 | DNK79_13905 | DNQ41_02320 | DNQ45_22690 | DNR41_18210 | DNX30_08340 | DNX30_30415 | DOY56_08405 | DOY56_28310 | DP258_24465 | DP277_20345 | DQE83_13430 | DQF57_23265 | DQO13_25445 | DS732_02490 | DS966_08015 | DS980_21175 | DS986_22660 | DTL41_15650 | DTL43_02180 | DTL84_03475 | DTL90_17415 | DTM10_04520 | DTM25_10760 | DTM27_17445 | DTM45_21120 | DU321_10250 | DU333_08470 | DW236_18435 | DWB25_22560 | DXT71_04095 | E0E06_20440 | E2112_14805 | E2119_06640 | E2126_03515 | E2132_24260 | E2855_05288 | E2863_05074 | E5M00_23410 | EAI42_02215 | EAI46_05880 | EAI52_08830 | EB509_04250 | EB510_02855 | EB515_02250 | EB515_27860 | EC1094V2_4112 | EC3234A_108c00490 | EC3426_00474 | EC382_20325 | EC95NR1_03759 | ECONIH1_24680 | ECTO124_04554 | ECTO6_04344 | ECs5123 | ED225_08650 | ED225_27885 | ED600_23000 | ED607_16095 | ED611_08920 | ED648_22350 | ED903_07135 | ED944_02250 | ED944_28235 | EEA45_03815 | EEA45_28010 | EEP23_07630 | EF173_02245 | EFV06_18575 | EFV08_22895 | EGT48_17620 | EGY17_11620 | EIA08_20150 | EIA21_18800 | EJC75_20455 | EJH97_22055 | EKI52_12835 | EL75_4023 | EL79_4201 | EL80_4117 | ELT33_14950 | ELU85_14360 | ELV00_11885 | ELV07_19830 | ELV11_06265 | ELV13_23120 | ELV26_07240 | ELV32_12775 | EO240_03395 | EO241_15020 | EPS76_03465 | EPS91_16030 | EPS94_17715 | EPS97_10035 | EPT01_10125 | EQ820_09385 | EQ823_13505 | EQ825_11040 | EQ830_14815 | ERL57_15315 | ERS085365_01232 | ERS085366_02368 | ERS085374_01720 | ERS085379_04165 | ERS085383_01551 | ERS085386_01026 | ERS085404_01347 | ERS085406_00138 | ERS085411_03241 | ERS085416_03699 | ERS139211_04025 | ERS150873_01288 | ERS150876_03931 | EVY14_04865 | EVY21_06135 | EWK56_08840 | EWK57_13005 | EXM29_20520 | EXX06_20580 | EXX13_20065 | EXX23_19140 | EXX24_09470 | EXX53_17250 | EXX55_21115 | EXX71_14850 | EXX78_13725 | EXX87_19170 | EYD11_20735 | EYY78_14815 | Eco118UI_24465 | ExPECSC022_04947 | ExPECSC036_01159 | ExPECSC038_04650 | ExPECSC065_03192 | FORC28_5529 | FORC82_4347 | GJ11_26025 | GroES protein | HMPREF3040_03031 | HW43_02405 | HmCms184_03268 | HmCmsJML074_01332 | HmCmsJML079_00813 | HmCmsJML146_00634 | HmCmsJML204_04032 | JD73_27615 | MJ49_08270 | MS6198_48620 | MS8345_04770 | NCTC10082_01858 | NCTC10090_02608 | NCTC10418_06722 | NCTC10764_04514 | NCTC10766_04979 | NCTC10767_00468 | NCTC10865_05651 | NCTC11022_04472 | NCTC11112_02718 | NCTC11124_00528 | NCTC11126_02234 | NCTC11181_01790 | NCTC11341_03018 | NCTC11560_04826 | NCTC12950_04950 | NCTC13125_02651 | NCTC13127_05945 | NCTC13148_04640 | NCTC13353_01581 | NCTC13462_02685 | NCTC13846_04308 | NCTC13919_01678 | NCTC7152_04525 | NCTC7922_05203 | NCTC7927_05028 | NCTC7928_03914 | NCTC8009_07994 | NCTC8179_00967 | NCTC8196_00513 | NCTC8450_00575 | NCTC8500_05096 | NCTC8621_04681 | NCTC8622_02020 | NCTC8959_04317 | NCTC8960_02052 | NCTC8985_03777 | NCTC9006_03367 | NCTC9007_00922 | NCTC9010_04690 | NCTC9036_04434 | NCTC9037_04612 | NCTC9044_02621 | NCTC9045_05355 | NCTC9050_02552 | NCTC9055_01425 | NCTC9058_02376 | NCTC9060_03946 | NCTC9062_03619 | NCTC9073_03985 | NCTC9075_06185 | NCTC9077_05691 | NCTC9110_04321 | NCTC9111_04721 | NCTC9117_05642 | NCTC9119_04736 | NCTC9434_02172 | NCTC9701_04823 | NCTC9703_03912 | NCTC9706_01823 | NCTC9775_02930 | NCTC9777_00951 | NCTC9963_04706 | NCTC9965_04673 | NCTC9969_04589 | PGD_03324 | PU06_23695 | Protein Cpn10 | RG28_06030 | RK56_012240 | RX35_04404 | SAMEA3472033_01790 | SAMEA3472043_02121 | SAMEA3472047_01721 | SAMEA3472055_04143 | SAMEA3472056_01661 | SAMEA3472067_02181 | SAMEA3472070_02800 | SAMEA3472080_00129 | SAMEA3472089_02867 | SAMEA3472090_01021 | SAMEA3472108_01593 | SAMEA3472110_00755 | SAMEA3472112_01088 | SAMEA3472114_01909 | SAMEA3472115_00493 | SAMEA3472121_05493 | SAMEA3472127_01594 | SAMEA3472147_02963 | SAMEA3484427_02050 | SAMEA3484429_03090 | SAMEA3484433_02854 | SAMEA3484434_04205 | SAMEA3485101_04770 | SAMEA3485103_02883 | SAMEA3485113_03473 | SAMEA3751239_02349 | SAMEA3751400_04221 | SAMEA3752372_01185 | SAMEA3752379_00846 | SAMEA3752553_04399 | SAMEA3752557_01638 | SAMEA3752559_00183 | SAMEA3752620_03453 | SAMEA3752743_01097 | SAMEA3753064_01579 | SAMEA3753070_03222 | SAMEA3753093_02617 | SAMEA3753106_03413 | SAMEA3753137_03296 | SAMEA3753164_04039 | SAMEA3753290_02068 | SAMEA3753300_00683 | SAMEA3753304_04546 | SAMEA3753391_00662 | SAMEA3753397_02630 | SK85_04505 | SY51_23890 | U14A_04541 | UC41_03560 | UN86_20665 | UN91_24960 | WM48_23015 | WQ89_21770 | WR15_07180 | YDC107_2865 | groS | groS_2 | mopB
Mol. Mass.:10384.31
Organism:Escherichia coli
Blast this sequence in BindingDB or PDB
  Blast E-value cutoff:
Synonyms:6-(3-(1-Adamantyl)-4-methoxyphenyl)-2-naphthoic acid | 6-(3-adamantan-1-yl-4-methoxyphenyl)naphthalene-2-carboxylic acid | ADAPALENE | CHEMBL1265
TypeSmall organic molecule
Emp. Form.C28H28O3
Mol. Mass.412.5201
SMILESCOc1ccc(cc1C12CC3CC(CC(C3)C1)C2)-c1ccc2cc(ccc2c1)C(O)=O |TLB:7:8:11:15.14.13,THB:9:10:13:17.8.16,9:8:11.10.15:13,16:8:11:15.14.13,16:14:11:17.9.8|