Retinoic acid receptor gamma
Meas. Tech.
0.620000±n/a nM
 Hibi, STagami, KKikuchi, KYoshimura, HTai, KHida, TTokuhara, NYamauchi, TNagai, M Syntheses and evaluation of naphthalenyl- and chromenyl-pyrrolyl-benzoic acids as potent and selective retinoic acid receptor alpha agonists. Bioorg Med Chem Lett 10:623-5 (2000) [PubMed]  Article
Retinoic acid receptor gamma
Nuclear receptor subfamily 1 group B member 3 | RAR-gamma | Retinoic acid receptor RXR-alpha/gamma | Retinoic acid receptor gamma | Retinoid receptor
Mol. Mass.:
Homo sapiens (Human)
9-cis-retinoic acid (9cRA) | ALL-TRANS-RETINOIC ACID | AT-RA | Atralin | CHEMBL38 | MLS000028588 | SMR000058245 | TRETINOIN | Vitamin A acid | [3H]RA | [3H]Retinoic acid | [3H]Vitamin A acid | [3H]tretinoin | all-trans retinoic acid | cid_444795
radiolabeled ligand
Emp. Form.:
Mol. Mass.:
C\C(\C=C\C1=C(C)CCCC1(C)C)=C/C=C/C(/C)=C/C(O)=O |c:4|
Search PDB for entries with ligand similarity: