Details for Substrate BDBM36388 without Explicit Binding Affinity Data | |
| Cathepsin Z |
| Cathepsin B |
| Cathepsin H |
Synonyms: | BDBM36404 | CID54445 | Octahydro-indolizine-1,6,7,8-tetraol, 13 |
Type: | Small organic molecule |
Emp. Form.: | C8H15NO4 |
Mol. Mass.: | 189.209 g/mol |
SMILES: | O[C@H]1CCN2C[C@H](O)[C@@H](O)[C@H](O)[C@@H]12 |
Structure: |
Courtesy of Chemaxon Inc. - Use mouse to adjust image. - Double-click and use "Edit" menu to generate mol-file. |