BDBM434551 US10562900, Example 29
SMILES COc1cc(OC)cc(c1)-c1ccc2c(NC(=O)c3ccc(cc3)N3C[C@H](C)N[C@H](C)C3)n[nH]c2c1
InChI Key InChIKey=QDQSXFYHTIEBGF-HDICACEKSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 434551
TargetFibroblast growth factor receptor 2(Homo sapiens (Human))
Shanghai Haihe Pharmaceutical
US Patent
Shanghai Haihe Pharmaceutical
US Patent
Affinity DataIC50: <100nMAssay Description:The enzyme reaction substrate Poly(Glu,Tyr) 4:1 was diluted with PBS without potassium ion (10 mM sodium phosphate buffer, 150 mM NaCl, pH7.2-7.4) to...More data for this Ligand-Target Pair
TargetFibroblast growth factor receptor 1(Homo sapiens (Human))
Shanghai Haihe Pharmaceutical
US Patent
Shanghai Haihe Pharmaceutical
US Patent
Affinity DataIC50: <100nMAssay Description:The enzyme reaction substrate Poly(Glu,Tyr) 4:1 was diluted with PBS without potassium ion (10 mM sodium phosphate buffer, 150 mM NaCl, pH7.2-7.4) to...More data for this Ligand-Target Pair