BDBM586066 US11530237, Compound 247::US11530237, Compound 249::US11542297, Compound 247
SMILES CSc1ccc2n(CC(=O)[C@H]3CC[C@H]4[C@@H]5CC[C@H]6C[C@](C)(O)CC[C@]6(C)[C@H]5CC[C@]34C)nnc2c1
InChI Key InChIKey=KUYRAGGLVKBBKQ-ZEMZJFDFSA-N
Data 3 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 3 hits for monomerid = 586066
Affinity DataIC50: 30nMAssay Description:Briefly, cortices are rapidly removed following decapitation of carbon dioxide-anesthetized Sprague-Dawley rats (200-250 g). The cortices are homogen...More data for this Ligand-Target Pair
TargetGamma-aminobutyric acid (GABA) B receptor 1(Rattus norvegicus (rat))
Sage Therapeutics
US Patent
Sage Therapeutics
US Patent
TargetGamma-aminobutyric acid (GABA) B receptor 1(Rattus norvegicus (rat))
Sage Therapeutics
US Patent
Sage Therapeutics
US Patent