Ki Summary BindingDB logo
myBDB logout
Reaction Details
Report a problem with these data
TargetAmine oxidase [flavin-containing] B
Meas. Tech.MAO A and MAO B Activity Measurements
Temperature298.15±n/a K
Ki 127000±n/a nM
Citation Hubalek, FBinda, CLi, MHerzig, YSterling, JYoudim, MBMattevi, AEdmondson, DE Inactivation of purified human recombinant monoamine oxidases A and B by rasagiline and its analogues. J Med Chem47:1760-6 (2004) [PubMed]  Article
More Info.:Get all data from this article,   Solution Info,  Assay Method
Amine oxidase [flavin-containing] B
Name:Amine oxidase [flavin-containing] B
Synonyms:MAO-B | Monoamine oxidase type B | Monoamine oxidase type B (MAO B) | Monoamine oxidase type B (MAO B) | Monoamine oxidase type B (MAOB)
Mol. Mass.:58768.76
Organism:Homo sapiens (Human)
Blast this sequence in BindingDB or PDB
  Blast E-value cutoff:
Synonyms:(1S)-N-(prop-2-yn-1-yl)-2,3-dihydro-1H-inden-1-amine | N-propargyl-1(S)-aminoindan | S-PAI | rasagiline analogue
TypeSmall organic molecule
Emp. Form.C12H13N
Mol. Mass.171.2383
SMILESC#CCN[C@H]1CCc2ccccc12 |r|
Synonyms:Benzenemethanamine | CHEMBL522 | benzylamine | phenylmethanamine
TypeSmall organic molecule
Emp. Form.C7H9N
Mol. Mass.107.1531