Ki Summary BindingDB logo
myBDB logout
Reaction Details
Report a problem with these data
Target60 kDa chaperonin
Meas. Tech.ChEMBL_1891100
Kd 9800±n/a nM
Citation Stevens, MAbdeen, SSalim, NRay, AMWashburn, AChitre, SSivinski, JPark, YHoang, QQChapman, EJohnson, SM HSP60/10 chaperonin systems are inhibited by a variety of approved drugs, natural products, and known bioactive molecules. Bioorg Med Chem Lett29:1106-1112 (2019) [PubMed]  Article
More Info.:Get all data from this article,  Assay Method
60 kDa chaperonin
Name:60 kDa chaperonin
Synonyms:60 kDa chaperonin | A8C65_01580 | A8G17_01625 | A8M42_07850 | A9R57_13545 | AA102_13095 | AC067_05505 | AC789_1c45570 | ACN002_4372 | ACN77_13925 | ACN81_06325 | ACU57_19295 | ACU90_27610 | AJ318_17205 | AKG99_18195 | AM266_00725 | AM270_14500 | AM446_25370 | AM464_15770 | AM465_02150 | AMK83_27450 | AML35_20705 | APT13_02995 | APT94_02245 | APZ14_01135 | ARC77_17990 | AU473_28145 | AUQ13_10300 | AUS26_18735 | AW059_20455 | AW106_26290 | AWE53_002045 | AWF59_005875 | AWG78_009865 | AXA56_02180 | AZE01_18030 | AZE03_09980 | B1K96_03090 | B7C53_14115 | B9M99_07795 | B9N28_21670 | B9N33_15905 | B9T59_10250 | BANRA_00108 | BANRA_00147 | BANRA_02787 | BANRA_02830 | BB545_11040 | BE963_12230 | BEN53_00765 | BER14_11410 | BFD68_08450 | BH694_19650 | BHF46_15625 | BHS81_24830 | BHS87_23225 | BIQ87_23895 | BIU72_06095 | BIZ41_02710 | BJJ90_23450 | BK248_23630 | BK292_23445 | BK334_08295 | BK373_03440 | BK375_06855 | BK383_12940 | BK400_02730 | BMT49_19180 | BMT53_11945 | BMT91_05495 | BN17_41231 | BON63_07075 | BON66_25750 | BON69_04690 | BON76_04275 | BON81_15965 | BON92_18275 | BON93_15345 | BON96_03715 | BSR05_14030 | BTQ04_18135 | BTQ06_07135 | BUE81_24315 | BVL39_04415 | BW690_22405 | BWP17_13605 | BXT93_23590 | BZL31_12950 | BZL69_06910 | BvCms12BK_04199 | BvCms2454_04385 | BvCms35BK_01935 | BvCmsA75A_02316 | BvCmsC61A_01711 | BvCmsF63A_01379 | BvCmsH15A_02826 | BvCmsHHP001_00679 | BvCmsHHP019_00806 | BvCmsHHP056_01305 | BvCmsJ76A_03971 | BvCmsKKP036_00132 | BvCmsKKP061_03324 | BvCmsKSNP019_03303 | BvCmsKSNP073_03447 | BvCmsKSNP081_01939 | BvCmsKSNP120_00880 | BvCmsKSP008_05437 | BvCmsKSP011_04701 | BvCmsKSP015_03624 | BvCmsKSP018_00066 | BvCmsKSP024_01292 | BvCmsKSP026_01573 | BvCmsKSP036_01506 | BvCmsKSP039_04907 | BvCmsKSP045_02508 | BvCmsKSP054_04830 | BvCmsKSP058_02605 | BvCmsKSP061_02112 | BvCmsKSP067_03875 | BvCmsKSP081_03343 | BvCmsKSP083_02935 | BvCmsNSNP006_03059 | BvCmsNSNP023_02526 | BvCmsNSNP027_03000 | BvCmsNSNP036_02363 | BvCmsNSP006_05622 | BvCmsNSP007_04896 | BvCmsNSP039_02859 | BvCmsNSP045_04079 | BvCmsNSP047_02052 | BvCmsNSP052_03163 | BvCmsNSP072_00461 | BvCmsNSP078_00002 | BvCmsOUP014_01585 | BvCmsSINP011_01477 | BvCmsSINP022_02410 | BvCmsSINP036_01420 | BvCmsSIP006_02882 | BvCmsSIP010_01340 | BvCmsSIP019_03074 | BvCmsSIP044_04391 | C1I39_24100 | C1I57_02515 | C1N95_001430 | C2858_12005 | C2M16_07145 | C2U48_11800 | C3449_11495 | C3B70_03755 | C3K24_17540 | C4K41_15740 | C4M78_05800 | C5715_24370 | C5N07_07010 | C5P01_11485 | C5P43_04990 | C5P44_18550 | C5P48_04550 | C6669_06700 | C6976_23915 | C6A57_08340 | C6B13_11455 | C7235_22800 | C7B02_22870 | C7B06_19620 | C7B07_19640 | C7B08_13320 | C7B18_22125 | C9025_24790 | C9083_18250 | C9200_11080 | C9212_22295 | C9255_05360 | C9299_14020 | C9E25_08280 | C9E67_27735 | C9Y80_28140 | C9Y95_08230 | CA593_05105 | CCZ08_19865 | CCZ11_19940 | CCZ14_19960 | CCZ16_17425 | CCZ17_16290 | CCZ18_09570 | CDL37_19955 | CG691_04055 | CG692_00055 | CG705_07485 | CG706_19960 | CI641_014245 | CI694_17140 | CIJ94_19305 | CLH66_25395 | COD30_28660 | COD46_17610 | CPA47_23805 | CQP61_24785 | CR539_02660 | CRD98_26740 | CRE06_15175 | CRM83_17505 | CRT43_24985 | CRT46_24625 | CRT55_26565 | CSB64_20580 | CT143_14485 | CT146_11195 | CU078_13310 | CUB99_10685 | CV83915_01888 | CVH05_06685 | CWM24_06435 | CWS33_03390 | CXB56_25445 | CY655_26170 | D0X26_12780 | D1900_07565 | D2183_06170 | D2184_07875 | D2185_07635 | D2F89_07880 | D3822_10750 | D3C88_27260 | D3I61_24435 | D3O91_01400 | D3Y67_00555 | D4M06_10270 | D4M06_29410 | D7K63_02295 | D7K66_01645 | D7Y10_20710 | D9D20_08430 | D9D31_08050 | D9D33_02520 | D9D43_14725 | D9E34_15015 | D9E35_09915 | D9E49_11975 | D9G11_15840 | D9G42_15395 | D9G48_11760 | D9H53_05445 | D9H68_15855 | D9H70_08850 | D9H94_06455 | D9I11_08160 | D9I18_04540 | D9I87_11050 | D9I88_12295 | D9I97_14780 | D9J03_08605 | D9J44_18175 | D9J46_16915 | D9J60_12275 | D9K48_05190 | D9K54_26350 | D9L89_02290 | D9L89_29680 | D9L99_20610 | D9N32_18890 | D9X97_13605 | D9X97_28710 | DAH26_05045 | DAH27_28010 | DAH36_09875 | DAH37_06370 | DD647_07895 | DD762_21030 | DDT63_05215 | DEN86_00710 | DEN89_17490 | DEO11_24170 | DEO19_26325 | DIV10_26330 | DK267_13570 | DK268_16985 | DK273_16835 | DK278_16485 | DK279_16720 | DK288_16415 | DK289_16810 | DKP82_04065 | DKP83_02480 | DKP87_04530 | DKP89_17860 | DL195_09030 | DL455_10645 | DL545_22730 | DL800_29220 | DM102_08870 | DM463_13480 | DMI04_11460 | DMI04_28175 | DNB37_06985 | DNB37_28240 | DNK79_13900 | DNQ41_02325 | DNQ45_22695 | DNR41_18215 | DNX30_08345 | DNX30_30410 | DOY56_08400 | DOY56_28305 | DP258_24460 | DP277_20350 | DQE83_13435 | DQF57_23270 | DQO13_25440 | DS732_02495 | DS966_08020 | DS980_21170 | DS986_22665 | DTL41_15645 | DTL43_02185 | DTL84_03470 | DTL90_17410 | DTM10_04525 | DTM25_10765 | DTM27_17440 | DTM45_21115 | DU321_10255 | DU333_08465 | DW236_18440 | DWB25_22555 | DXT71_04100 | E0E06_20445 | E2112_14800 | E2126_03520 | E2132_24265 | E2855_05287 | E2863_05073 | E5M00_23405 | EAI42_02210 | EAI46_05875 | EAI52_08825 | EB509_04245 | EB510_02850 | EB515_02245 | EB515_27855 | EC1094V2_4111 | EC3234A_108c00480 | EC3426_00475 | EC382_20320 | EC95NR1_03760 | ECONIH1_24685 | ECTO124_04553 | ECTO6_04343 | ECs5124 | ED225_08645 | ED225_27880 | ED600_22995 | ED607_16100 | ED611_08915 | ED903_07130 | ED944_02245 | ED944_28230 | EEA45_03810 | EEA45_28005 | EEP23_07625 | EF173_02240 | EFV08_22890 | EGT48_17625 | EGY17_11625 | EIA08_20145 | EIA21_18795 | EJC75_20460 | EJH97_22050 | EKI52_12830 | EL75_4022 | EL79_4200 | EL80_4116 | ELT33_14955 | ELU85_14365 | ELV00_11890 | ELV11_06260 | ELV13_23125 | ELV26_07245 | ELV32_12780 | EO240_03400 | EO241_15015 | EPS76_03470 | EPS91_16025 | EPS94_17720 | EPS97_10040 | EQ823_13510 | EQ830_14810 | ERS085365_01231 | ERS085366_02367 | ERS085374_01721 | ERS085379_04164 | ERS085383_01552 | ERS085386_01025 | ERS085404_01348 | ERS085416_03698 | ERS139211_04024 | ERS150873_01289 | ERS150876_03930 | EVY14_04860 | EVY21_06130 | EWK56_08835 | EWK57_13010 | EXM29_20525 | EXX06_20585 | EXX13_20070 | EXX23_19135 | EXX24_09465 | EXX53_17255 | EXX55_21120 | EXX71_14845 | EXX78_13730 | EXX87_19165 | EYD11_20730 | EYY78_14820 | Eco118UI_24470 | ExPECSC022_04946 | ExPECSC036_01160 | ExPECSC038_04651 | ExPECSC065_03193 | FORC28_5528 | FORC82_4346 | GJ11_26030 | GroEL protein | HMPREF3040_03032 | HmCms184_03267 | HmCmsJML074_01333 | HmCmsJML079_00812 | HmCmsJML146_00635 | HmCmsJML204_04031 | JD73_27620 | MJ49_08265 | MS6198_48630 | MS8345_04771 | NCTC10082_01857 | NCTC10090_02607 | NCTC10418_06721 | NCTC10764_04513 | NCTC10767_00467 | NCTC10865_05650 | NCTC11022_04473 | NCTC11112_02719 | NCTC11181_01789 | NCTC11341_03019 | NCTC11560_04827 | NCTC12950_04949 | NCTC13125_02650 | NCTC13127_05944 | NCTC13353_01582 | NCTC13462_02684 | NCTC13846_04307 | NCTC13919_01679 | NCTC7152_04524 | NCTC7927_05027 | NCTC8450_00576 | NCTC8500_05095 | NCTC8621_04680 | NCTC8622_02021 | NCTC8959_04316 | NCTC8960_02051 | NCTC9006_03366 | NCTC9007_00921 | NCTC9010_04689 | NCTC9036_04433 | NCTC9037_04611 | NCTC9044_02622 | NCTC9045_05354 | NCTC9050_02551 | NCTC9055_01424 | NCTC9058_02377 | NCTC9060_03947 | NCTC9062_03620 | NCTC9073_03984 | NCTC9077_05690 | NCTC9081_01494 | NCTC9110_04320 | NCTC9111_04720 | NCTC9117_05641 | NCTC9119_04735 | NCTC9434_02173 | NCTC9701_04822 | NCTC9702_05313 | NCTC9703_03911 | NCTC9706_01822 | NCTC9775_02929 | NCTC9777_00950 | NCTC9963_04705 | NCTC9965_04672 | NCTC9969_04590 | PGD_03325 | PU06_23700 | Protein Cpn60 | RG28_06025 | RK56_012245 | RX35_04405 | SAMEA3472033_01789 | SAMEA3472043_02122 | SAMEA3472044_01554 | SAMEA3472047_01720 | SAMEA3472055_04142 | SAMEA3472056_01662 | SAMEA3472067_02182 | SAMEA3472070_02799 | SAMEA3472080_00128 | SAMEA3472089_02866 | SAMEA3472090_01020 | SAMEA3472110_00754 | SAMEA3472112_01087 | SAMEA3472114_01908 | SAMEA3472115_00492 | SAMEA3472121_05492 | SAMEA3472127_01593 | SAMEA3484427_02051 | SAMEA3484429_03091 | SAMEA3484433_02853 | SAMEA3484434_04204 | SAMEA3485101_04769 | SAMEA3485103_02882 | SAMEA3485113_03474 | SAMEA3751239_02348 | SAMEA3751400_04220 | SAMEA3752372_01184 | SAMEA3752379_00847 | SAMEA3752553_04400 | SAMEA3752559_00182 | SAMEA3752620_03454 | SAMEA3752743_01098 | SAMEA3753064_01580 | SAMEA3753070_03223 | SAMEA3753093_02616 | SAMEA3753097_01210 | SAMEA3753106_03412 | SAMEA3753137_03297 | SAMEA3753164_04038 | SAMEA3753290_02069 | SAMEA3753300_00682 | SAMEA3753304_04545 | SAMEA3753391_00661 | SAMEA3753397_02631 | SK85_04506 | SY51_23895 | U14A_04542 | UC41_03555 | UN91_24955 | WQ89_21775 | WR15_07175 | YDC107_2866 | groL | groL_2 | mopA
Mol. Mass.:57309.59
Organism:Escherichia coli
Blast this sequence in BindingDB or PDB
  Blast E-value cutoff:
TypeSmall organic molecule
Emp. Form.C51H40N6O23S6
Mol. Mass.1297.28
SMILESCC1=CCC(=C\C1=N\C(=O)C1=CC=C\C(C1)=N/C(=O)/N=C1/CC(=CC=C1)C(=O)\N=C1\CC(=CC=C1C)C(=O)\N=C1/CC=C(c2cc(cc(c12)S(O)(=O)=O)S(O)(=O)=O)S(O)(=O)=O)C(=O)\N=C1/CC=C(c2cc(cc(c12)S(O)(=O)=O)S(O)(=O)=O)S(O)(=O)=O |c:4,13,24,26,34,36,45,72,t:1,11|