Details for Substrate BDBM10848 without Explicit Binding Affinity Data | |
| Chitotriosidase-1 |
| Endochitinase B1 |
| Chitinase B |
Synonyms: | 4-methylumbelliferyl beta-D-N,N-diacetylchitobiose | 4MU-NAG2, Sigma | N-[(2S,3R,4R,5S,6R)-2-{[(2R,3S,4R,5R,6S)-5-acetamido-4-hydroxy-2-(hydroxymethyl)-6-[(4-methyl-2-oxo-2H-chromen-7-yl)oxy]oxan-3-yl]oxy}-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide | fluorogenic substrate |
Type: | Small organic molecule |
Emp. Form.: | C26H34N2O13 |
Mol. Mass.: | 582.5538 g/mol |
SMILES: | CC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@@H](Oc2ccc3c(C)cc(=O)oc3c2)[C@H](NC(C)=O)[C@H]1O |r| |
Structure: |
Courtesy of Chemaxon Inc. - Use mouse to adjust image. - Double-click and use "Edit" menu to generate mol-file. |