Details for Substrate BDBM19254 without Explicit Binding Affinity Data | |
| Inosine-5'-monophosphate dehydrogenase 2 |
| Inosine-5'-monophosphate dehydrogenase 1 |
Synonyms: | IMP | Inosine | Inosinic acid | US11185100, TABLE 11.2 | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-3H-purin-9-yl)oxolan-2-yl]methyl dihydrogen | inosine monophosphate | {[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-6,9-dihydro-3H-purin-9-yl)oxolan-2-yl]methoxy}phosphonic acid |
Type: | Nucleoside or nucleotide |
Emp. Form.: | C10H13N4O8P |
Mol. Mass.: | 348.206 g/mol |
SMILES: | O[C@@H]1[C@@H](COP(O)(O)=O)O[C@H]([C@@H]1O)n1cnc2c1nc[nH]c2=O |r| |
Structure: |
Courtesy of Chemaxon Inc. - Use mouse to adjust image. - Double-click and use "Edit" menu to generate mol-file. |