Details for Substrate BDBM22166 without Explicit Binding Affinity Data | |
| Sodium-dependent dopamine transporter |
| Sodium-dependent noradrenaline transporter |
| Sodium-dependent serotonin transporter |
Synonyms: | 3-(4-iodophenyl)tropane-2-carboxylic acid methyl ester | Beta-CIT | CHEMBL215376 | RTI 55, (exo,exo)-isomer, Iodine (125) labeled | RTI-258 | RTI-55 | [125I]RTI-55 | methyl (1R,2S,3S,5S)-3-(4-iodophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
Type: | radiolabeled ligand |
Emp. Form.: | C16H20INO2 |
Mol. Mass.: | 385.24 g/mol |
SMILES: | [H][C@]12CC[C@]([H])([C@H]([C@H](C1)c1ccc(I)cc1)C(=O)OC)N2C |TLB:16:6:20:3.2| |
Structure: |
Courtesy of Chemaxon Inc. - Use mouse to adjust image. - Double-click and use "Edit" menu to generate mol-file. |