Details for Substrate BDBM25149 without Explicit Binding Affinity Data | |
| Histone deacetylase 4 [648-729,745-1057] |
| Histone deacetylase 5 |
| Histone deacetylase 4 |
| Histone deacetylase 7 |
Synonyms: | Boc-L-Lys-MCA | tert-butyl N-[(1S)-1-[(4-methyl-2-oxo-2H-chromen-7-yl)carbamoyl]-5-(2,2,2-trifluoroacetamido)pentyl]carbamate | tert-butyl {(1S)-1-{[(4-methyl-2-oxo-2H-chromen-7-yl)amino]carbonyl}-5-[(trifluoroacetyl)amino]pentyl}carbamate |
Type: | Small organic molecule |
Emp. Form.: | C23H28F3N3O6 |
Mol. Mass.: | 499.4801 g/mol |
SMILES: | Cc1cc(=O)oc2cc(NC(=O)[C@H](CCCCNC(=O)C(F)(F)F)NC(=O)OC(C)(C)C)ccc12 |
Structure: |
Courtesy of Chemaxon Inc. - Use mouse to adjust image. - Double-click and use "Edit" menu to generate mol-file. |