BDBM159102 US10093663, Example 4b::US9682968, Example-3
SMILES COC1CCN(Cc2c(C)cc(C)c3[nH]ccc23)C(C1)c1ccccc1
InChI Key
Data 8 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 8 hits for monomerid = 159102
Affinity DataIC50: 6nMAssay Description:CVF-Bb complex prepared from purified cobra venom factor (1 μM), recombinant human complement factor B (expressed in drosophila cells and purifi...More data for this Ligand-Target Pair
Affinity DataIC50: 6.00E+3nMpH: 7.4 T: 2°CAssay Description:CVF-Bb complex prepared from purified cobra venom factor (1 μM), recombinant human complement factor B (expressed in drosophila cells and purifi...More data for this Ligand-Target Pair
Affinity DataIC50: 6.70E+4nMpH: 7.4 T: 2°CAssay Description:CVF-Bb complex prepared from purified cobra venom factor (1 μM), recombinant human complement factor B (expressed in drosophila cells and purifi...More data for this Ligand-Target Pair
Affinity DataIC50: 6.80E+4nMAssay Description:Inhibition of human serine protease factor B by TR-FRET based competition binding assayMore data for this Ligand-Target Pair
Affinity DataIC50: 1.40E+3nMAssay Description:Inhibition of human serine protease factor B catalytic domain (D470 to L764 residues) assessed as inhibition of cleavage cobra venom factor (CVF):Bb ...More data for this Ligand-Target Pair
Affinity DataIC50: 1.40E+3nMAssay Description:Inhibition of human serine protease factor B catalytic domain (D470 to L764 residues) assessed as inhibition of cleavage cobra venom factor (CVF):Bb ...More data for this Ligand-Target Pair
Affinity DataIC50: 6.80E+4nMAssay Description:Inhibition of human serine protease factor B by TR-FRET based competition binding assayMore data for this Ligand-Target Pair
Affinity DataIC50: 720nMpH: 7.4 T: 2°CAssay Description:CVF-Bb complex prepared from purified cobra venom factor (1 μM), recombinant human complement factor B (expressed in drosophila cells and purifi...More data for this Ligand-Target Pair