BDBM18887 3,5-Dibromo-4-alkoxyphenylalkanoic Acid, 9k::3-[3,5-dibromo-4-(cyclohexylmethoxy)phenyl]propanoic acid::JMC496635 Compound 9::cyclohexyl derivative, 7

SMILES OC(=O)CCc1cc(Br)c(OCC2CCCCC2)c(Br)c1

InChI Key InChIKey=UQABRPIJAIHKQN-UHFFFAOYSA-N

Data  7 IC50  2 EC50

  Tab Delimited (TSV)   2D SDfile   Computed 3D by Vconf -m prep SDfile
Find this compound or compounds like it in BindingDB:
   Substructure
Similarity at least:  must be >=0.5
Exact match

Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB

Found 7 hits for monomerid = 18887   

TargetThyroid hormone receptor beta(Homo sapiens (Human))
Karo Bio

LigandPNGBDBM18887(3,5-Dibromo-4-alkoxyphenylalkanoic Acid, 9k | 3-[3...)
Affinity DataIC50:  190nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRbeta.More data for this Ligand-Target Pair
In DepthDetails ArticlePubMed
TargetThyroid hormone receptor alpha(Homo sapiens (Human))
Karo Bio

LigandPNGBDBM18887(3,5-Dibromo-4-alkoxyphenylalkanoic Acid, 9k | 3-[3...)
Affinity DataIC50:  460nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRalpha. More data for this Ligand-Target Pair
In DepthDetails ArticlePubMed
TargetThyroid hormone receptor alpha(Homo sapiens (Human))
Karo Bio

LigandPNGBDBM18887(3,5-Dibromo-4-alkoxyphenylalkanoic Acid, 9k | 3-[3...)
Affinity DataIC50:  460nM EC50:  0.530nMpH: 7.0 T: 2°CAssay Description:IIC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRalpha. EC50 is the concentration of compound required to...More data for this Ligand-Target Pair
In DepthDetails ArticlePubMed
TargetThyroid hormone receptor beta(Homo sapiens (Human))
Karo Bio

LigandPNGBDBM18887(3,5-Dibromo-4-alkoxyphenylalkanoic Acid, 9k | 3-[3...)
Affinity DataIC50:  191nMAssay Description:Inhibition of human thyroid hormone receptor beta 1More data for this Ligand-Target Pair
In DepthDetails ArticlePubMed
TargetThyroid hormone receptor alpha(Homo sapiens (Human))
Karo Bio

LigandPNGBDBM18887(3,5-Dibromo-4-alkoxyphenylalkanoic Acid, 9k | 3-[3...)
Affinity DataIC50:  460nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRalpha. More data for this Ligand-Target Pair
In DepthDetails ArticlePubMed
TargetThyroid hormone receptor beta(Homo sapiens (Human))
Karo Bio

LigandPNGBDBM18887(3,5-Dibromo-4-alkoxyphenylalkanoic Acid, 9k | 3-[3...)
Affinity DataIC50:  190nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRbeta.More data for this Ligand-Target Pair
In DepthDetails ArticlePubMed
TargetThyroid hormone receptor beta(Homo sapiens (Human))
Karo Bio

LigandPNGBDBM18887(3,5-Dibromo-4-alkoxyphenylalkanoic Acid, 9k | 3-[3...)
Affinity DataIC50:  190nM EC50:  0.120nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRbeta. EC50 is the concentration of compound required to i...More data for this Ligand-Target Pair
In DepthDetails ArticlePubMed