BDBM434539 US10562900, Example 17
SMILES COc1cc(OC)c(Cl)c(c1Cl)-c1ccc2c(NC(=O)c3ccc(cc3)N3CCOCC3)n[nH]c2c1
InChI Key InChIKey=STGTYMWAEYUNQI-UHFFFAOYSA-N
Data 4 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 4 hits for monomerid = 434539
TargetVascular endothelial growth factor receptor 2(Homo sapiens (Human))
Shanghai Haihe Pharmaceutical
US Patent
Shanghai Haihe Pharmaceutical
US Patent
Affinity DataIC50: 600nMAssay Description:The enzyme reaction substrate Poly(Glu,Tyr) 4:1 was diluted with PBS without potassium ion (10 mM sodium phosphate buffer, 150 mM NaCl, pH7.2-7.4) to...More data for this Ligand-Target Pair
TargetFibroblast growth factor receptor 3(Homo sapiens (Human))
Shanghai Haihe Pharmaceutical
US Patent
Shanghai Haihe Pharmaceutical
US Patent
Affinity DataIC50: <100nMAssay Description:The enzyme reaction substrate Poly(Glu,Tyr) 4:1 was diluted with PBS without potassium ion (10 mM sodium phosphate buffer, 150 mM NaCl, pH7.2-7.4) to...More data for this Ligand-Target Pair
TargetFibroblast growth factor receptor 2(Homo sapiens (Human))
Shanghai Haihe Pharmaceutical
US Patent
Shanghai Haihe Pharmaceutical
US Patent
Affinity DataIC50: <100nMAssay Description:The enzyme reaction substrate Poly(Glu,Tyr) 4:1 was diluted with PBS without potassium ion (10 mM sodium phosphate buffer, 150 mM NaCl, pH7.2-7.4) to...More data for this Ligand-Target Pair
TargetFibroblast growth factor receptor 1(Homo sapiens (Human))
Shanghai Haihe Pharmaceutical
US Patent
Shanghai Haihe Pharmaceutical
US Patent
Affinity DataIC50: <100nMAssay Description:The enzyme reaction substrate Poly(Glu,Tyr) 4:1 was diluted with PBS without potassium ion (10 mM sodium phosphate buffer, 150 mM NaCl, pH7.2-7.4) to...More data for this Ligand-Target Pair