BDBM50289559 CHEMBL39475::N-((S)-1-Carbamimidoyl-2-hydroxy-piperidin-3-yl)-2-(2-methyl-6-oxo-5-phenylmethanesulfonylamino-6H-pyrimidin-1-yl)-acetamide
SMILES Cc1ncc(NS(=O)(=O)Cc2ccccc2)c(=O)n1CC(=O)N[C@H]1CCCN(C1O)C(N)=N
InChI Key InChIKey=PGUYNSUWECOWIP-BUSXIPJBSA-N
Data 5 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 5 hits for monomerid = 50289559
Affinity DataIC50: >2.50E+3nMAssay Description:Inhibitory concentration of the compound required to inhibit human plasmin enzyme was determinedMore data for this Ligand-Target Pair
Affinity DataIC50: 905nMAssay Description:Inhibitory concentration of the compound required to inhibit human factor Xa enzyme was determinedMore data for this Ligand-Target Pair
Affinity DataIC50: 160nMAssay Description:Inhibitory concentration of the compound required to inhibit human trypsin enzyme was determinedMore data for this Ligand-Target Pair
Affinity DataIC50: >2.50E+3nMAssay Description:Inhibitory concentration of the compound required to inhibit human Tissue type plasminogen activator was determinedMore data for this Ligand-Target Pair
Affinity DataIC50: 2.30nMAssay Description:Inhibitory concentration of the compound required to inhibit human thrombin enzyme was determinedMore data for this Ligand-Target Pair