BDBM50555575 C-18112003-G::GNS-1480::GNS1480::JNJ-73841937-AAA::Lazertinib::US11267810, Example T-6::YH-25448::Yh25448
SMILES COc1cc(N2CCOCC2)c(NC(=O)C=C)cc1Nc1nccc(n1)-n1cc(CN(C)C)c(n1)-c1ccccc1
InChI Key InChIKey=RRMJMHOQSALEJJ-UHFFFAOYSA-N
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 6 hits for monomerid = 50555575
TargetEpidermal growth factor receptor [T790M,L858R](Homo sapiens (Human))
Shenzhen Targetrx
US Patent
Shenzhen Targetrx
US Patent
Affinity DataIC50: <0.300nMAssay Description:WT EGFR and EGFR [L858R/T790M] kinase assay: WT EGFR or EGFR [L858R/T790M] kinase was mixed with different concentrations of pre-diluted compounds fo...More data for this Ligand-Target Pair
TargetEpidermal growth factor receptor [T790M,L858R](Homo sapiens (Human))
Shenzhen Targetrx
US Patent
Shenzhen Targetrx
US Patent
Affinity DataIC50: <0.300nMAssay Description:WT EGFR and EGFR [L858R/T790M] kinase assay: WT EGFR or EGFR [L858R/T790M] kinase was mixed with different concentrations of pre-diluted compounds fo...More data for this Ligand-Target Pair
TargetEpidermal growth factor receptor [T790M,L858R](Homo sapiens (Human))
Shenzhen Targetrx
US Patent
Shenzhen Targetrx
US Patent
Affinity DataIC50: <0.300nMAssay Description:WT EGFR and EGFR [L858R/T790M] kinase assay: WT EGFR or EGFR [L858R/T790M] kinase was mixed with different concentrations of pre-diluted compounds fo...More data for this Ligand-Target Pair
TargetEpidermal growth factor receptor [T790M,L858R](Homo sapiens (Human))
Shenzhen Targetrx
US Patent
Shenzhen Targetrx
US Patent
Affinity DataIC50: <0.300nMAssay Description:WT EGFR and EGFR [L858R/T790M] kinase assay: WT EGFR or EGFR [L858R/T790M] kinase was mixed with different concentrations of pre-diluted compounds fo...More data for this Ligand-Target Pair
TargetEpidermal growth factor receptor [T790M,L858R](Homo sapiens (Human))
Shenzhen Targetrx
US Patent
Shenzhen Targetrx
US Patent
Affinity DataIC50: <0.300nMAssay Description:WT EGFR and EGFR [L858R/T790M] kinase assay: WT EGFR or EGFR [L858R/T790M] kinase was mixed with different concentrations of pre-diluted compounds fo...More data for this Ligand-Target Pair
TargetEpidermal growth factor receptor [T790M,L858R](Homo sapiens (Human))
Shenzhen Targetrx
US Patent
Shenzhen Targetrx
US Patent
Affinity DataIC50: <0.300nMAssay Description:WT EGFR and EGFR [L858R/T790M] kinase assay: WT EGFR or EGFR [L858R/T790M] kinase was mixed with different concentrations of pre-diluted compounds fo...More data for this Ligand-Target Pair