BDBM150737 4‐chloro‐2‐{[3‐ (trifluoromethyl)phenyl]carbamoyl}phenyl diethyl phosphate (17)
SMILES CCOP(=O)(OCC)Oc1ccc(Cl)cc1C(=O)Nc1cccc(c1)C(F)(F)F
InChI Key InChIKey=GPDPNSSTNLSEPP-UHFFFAOYSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 150737
Affinity DataIC50: 2.48E+4nMAssay Description:The reaction mixture containing phosphate buffer, AChE or BChE and chosen compounds was prepared and intensively stirred. In given times (5, 10, 15, ...More data for this Ligand-Target Pair
Affinity DataIC50: 5.15E+4nMAssay Description:The reaction mixture containing phosphate buffer, AChE or BChE and chosen compounds was prepared and intensively stirred. In given times (5, 10, 15, ...More data for this Ligand-Target Pair