BDBM150747 5-chloro-2-{[4-(trifluoromethyl)phenyl]carbamoyl}phenyl diethyl phosphate (27)
SMILES CCOP(=O)(OCC)Oc1cc(Cl)ccc1C(=O)Nc1ccc(cc1)C(F)(F)F
InChI Key InChIKey=FCJBSKXAIZLLCA-UHFFFAOYSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 150747
Affinity DataIC50: 9.84E+3nMAssay Description:The reaction mixture containing phosphate buffer, AChE or BChE and chosen compounds was prepared and intensively stirred. In given times (5, 10, 15, ...More data for this Ligand-Target Pair
Affinity DataIC50: 8.63E+4nMAssay Description:The reaction mixture containing phosphate buffer, AChE or BChE and chosen compounds was prepared and intensively stirred. In given times (5, 10, 15, ...More data for this Ligand-Target Pair