BDBM18906 3,5-Dibromo-4-alkoxyphenylalkanoic Acid, 9i::3-[3,5-dibromo-4-(hexyloxy)phenyl]propanoic acid
SMILES CCCCCCOc1c(Br)cc(CCC(O)=O)cc1Br
InChI Key InChIKey=FVDRTJXVCUAOCA-UHFFFAOYSA-N
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 5 hits for monomerid = 18906
Affinity DataIC50: 1.10E+3nM EC50: 0.600nMpH: 7.0 T: 2°CAssay Description:IIC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRalpha. EC50 is the concentration of compound required to...More data for this Ligand-Target Pair
Affinity DataIC50: 360nM EC50: 1nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRbeta. EC50 is the concentration of compound required to i...More data for this Ligand-Target Pair
Affinity DataIC50: 363nMAssay Description:Inhibition of thyroid hormone receptor betaMore data for this Ligand-Target Pair
Affinity DataIC50: 363nMAssay Description:Inhibition of human thyroid hormone receptor beta 1More data for this Ligand-Target Pair
Affinity DataIC50: 1.10E+3nMAssay Description:Inhibition of thyroid hormone receptor alphaMore data for this Ligand-Target Pair
