BDBM19234 4-{4-[3-(4-{[benzyl(3-methanesulfonamido-2-methylphenyl)amino]methyl}phenoxy)phenoxy]butanamido}butanoic acid::4-{[4-(3-{4-[(Benzyl{2-methyl-3-[(methylsulfonyl)amino]-phenyl}amino)methyl]phenoxy}phenoxy)butanoyl]-amino}butanoic Acid::CHEMBL185265::GR sulfonamide modulator, 4
SMILES Cc1c(NS(C)(=O)=O)cccc1N(Cc1ccccc1)Cc1ccc(Oc2cccc(OCCCC(=O)NCCCC(O)=O)c2)cc1
InChI Key InChIKey=KHLLMEXZTPDMCY-UHFFFAOYSA-N
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 7 hits for monomerid = 19234
Affinity DataIC50: 0.600nM EC50: 86nMpH: 8.0 T: 2°CAssay Description:For compounds able to displace the 3(H)-dexamethasone from the receptor an IC50 value (the concentration required to inhibit 50% of the binding of 3(...More data for this Ligand-Target Pair
Affinity DataIC50: 0.600nMAssay Description:Inhibition of [3H]dexamethasone binding to glucocorticoid receptorMore data for this Ligand-Target Pair
Affinity DataIC50: 1nMpH: 8.0 T: 2°CAssay Description:For compounds able to displace the radiolabeled ligand (competitor) from the receptor an IC50 value (the concentration required to inhibit 50% of the...More data for this Ligand-Target Pair
Affinity DataIC50: 86nMAssay Description:Inhibition of glucocorticoid receptor Dexamethasone responseMore data for this Ligand-Target Pair
Affinity DataIC50: 120nMpH: 8.0 T: 2°CAssay Description:For compounds able to displace the radiolabeled ligand (competitor) from the receptor an IC50 value (the concentration required to inhibit 50% of the...More data for this Ligand-Target Pair
Affinity DataIC50: 550nMpH: 8.0 T: 2°CAssay Description:For compounds able to displace the radiolabeled ligand (competitor) from the receptor an IC50 value (the concentration required to inhibit 50% of the...More data for this Ligand-Target Pair
Affinity DataIC50: 1.60E+3nMpH: 8.0 T: 2°CAssay Description:For compounds able to displace the radiolabeled ligand (competitor) from the receptor an IC50 value (the concentration required to inhibit 50% of the...More data for this Ligand-Target Pair
