BDBM19235 2-{5-[4-({[(2,4-difluorophenyl)methyl](3-methanesulfonamido-2-methylphenyl)amino}methyl)phenoxy]-2-fluorophenoxy}acetic acid::GR sulfonamide modulator, 12
SMILES Cc1c(NS(C)(=O)=O)cccc1N(Cc1ccc(Oc2ccc(F)c(OCC(O)=O)c2)cc1)Cc1ccc(F)cc1F
InChI Key InChIKey=SEVGDNHYESBDRZ-UHFFFAOYSA-N
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 3 hits for monomerid = 19235
Affinity DataIC50: 0.200nMpH: 8.0 T: 2°CAssay Description:For compounds able to displace the radiolabeled ligand (competitor) from the receptor an IC50 value (the concentration required to inhibit 50% of the...More data for this Ligand-Target Pair
Affinity DataIC50: 4.80nM EC50: 440nMpH: 8.0 T: 2°CAssay Description:For compounds able to displace the 3(H)-dexamethasone from the receptor an IC50 value (the concentration required to inhibit 50% of the binding of 3(...More data for this Ligand-Target Pair
Affinity DataIC50: 180nMpH: 8.0 T: 2°CAssay Description:For compounds able to displace the radiolabeled ligand (competitor) from the receptor an IC50 value (the concentration required to inhibit 50% of the...More data for this Ligand-Target Pair
