BDBM258711 US9499482, 110
SMILES CCc1cc(ccc1OCCN1CCCC1)N1CC[C@H](Oc2ccc(cc2)-c2ccccc2)C1=O
InChI Key InChIKey=RXAQLHFQYNZJCP-LJAQVGFWSA-N
Data 1 KI
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 1 hit for monomerid = 258711
Affinity DataKi: 0.5nMpH: 7.4Assay Description:An in vitro binding assay was used to determine the compound Ki value or ability to antagonize binding of a peptide agonist to the human melanin conc...More data for this Ligand-Target Pair