BDBM286219 7-methyl-2-(6-methylpyridin-3- yl)-3-methylimidazo[1,2- a]pyridine::US9518055, Example 16
SMILES Cc1c(nc2cc(C)ccn12)-c1cnccc1C
InChI Key InChIKey=MURZJPCIAYYNPU-UHFFFAOYSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 286219
Affinity DataIC50: 68nMAssay Description:V79 cell lines stably expressing the either the human CYP11B2 or the human CYP11B1 enzyme were generated using a standard transfection protocol. V79 ...More data for this Ligand-Target Pair
Affinity DataIC50: 204nMAssay Description:V79 cell lines stably expressing the either the human CYP11B2 or the human CYP11B1 enzyme were generated using a standard transfection protocol. V79 ...More data for this Ligand-Target Pair