BDBM609792 US11707539, Compound 4613B
SMILES C[C@@H](NC(=O)c1ccc(NNC(=O)CCCCCC2=C(\C=C\C3=C(Oc4ccc(cc4)S(O)(=O)=O)\C(\CCC3)=C\C=C3\N(CCCCS(O)(=O)=O)c4ccc(cc4C3(C)C)S(O)(=O)=O)C(C)(C)c3cc(ccc23)S(O)(=O)=O)nc1)C(=O)N1CCC[C@H]1B(O)O
InChI Key InChIKey=WYXUOAHCHCVVCT-UHFFFAOYSA-N
Data 3 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 3 hits for monomerid = 609792
Affinity DataIC50: 8.80nMAssay Description:The purpose of this assay is to determine the IC50 of various inhibitors against recombinant human dipeptidyl peptidase IV (DPPIV), fibroblast activa...More data for this Ligand-Target Pair
Affinity DataIC50: 390nMAssay Description:The purpose of this assay is to determine the IC50 of various inhibitors against recombinant human dipeptidyl peptidase IV (DPPIV), fibroblast activa...More data for this Ligand-Target Pair
Affinity DataIC50: 1.00E+5nMAssay Description:The purpose of this assay is to determine the IC50 of various inhibitors against recombinant human dipeptidyl peptidase IV (DPPIV), fibroblast activa...More data for this Ligand-Target Pair
