BDBM675526 (S)-2-((2-(1-(3-Ethoxy-4-Methoxyphenyl)-2-(Methylsulfonyl)Ethyl)-1,3-Dioxo Isoindolin-4-Yl)Amino)-2-Oxoethyl 2,2-Dimethyl-3-(Nitrooxy)Propanoate::US11987556, Compound 1
SMILES CCOc1cc(ccc1OC)[C@@H](CS(C)(=O)=O)N1C(=O)c2cccc(NC(=O)COC(=O)C(C)(C)CO[N+]([O-])=O)c2C1=O
InChI Key InChIKey=IPKVILGIKCLNTJ-UHFFFAOYSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 675526
TargetcAMP-specific 3',5'-cyclic phosphodiesterase 4A(Human)
Biofront Therapeutics (Beijing) Co.
US Patent
Biofront Therapeutics (Beijing) Co.
US Patent
Affinity DataIC50: 178nMAssay Description:The inhibition of PDE4 (e.g., PDE4A, PDE4C) activity by the compounds (e.g., compound-1, compound-2, compound-3, compound-4, compound-5, and compound...More data for this Ligand-Target Pair
TargetcAMP-specific 3',5'-cyclic phosphodiesterase 4C(Human)
Biofront Therapeutics (Beijing) Co.
US Patent
Biofront Therapeutics (Beijing) Co.
US Patent
Affinity DataIC50: 2.23E+3nMAssay Description:The inhibition of PDE4 (e.g., PDE4A, PDE4C) activity by the compounds (e.g., compound-1, compound-2, compound-3, compound-4, compound-5, and compound...More data for this Ligand-Target Pair
