BDBM735615 US20250129103, Compound 202
SMILES Cc1nccc(/C=C/C(=O)N2CCN(c3nc(OCC45CCCN4CCC5)nc4c3CCN(c3cccc5cccc(Cl)c35)C4)C[C@@H]2CC#N)n1
InChI Key
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 735615
TargetPhosphatidylinositol 4-kinase alpha/GTPase KRas [1-169,G12C,C51S,C80L,C118S](Human)
Frontier Medicines
US Patent
Frontier Medicines
US Patent
Affinity DataIC50: 10nMAssay Description:The AlphaScreen technology was used to determine IC50S for compound inhibition of KRAS G12C (present as the Cys-light (C51S, C80L and C118S), truncat...More data for this Ligand-Target Pair
TargetRAF Proto-oncogen Serine/Threonine-Protein Kinase/GTPase KRas [1-169,G12C,C51S,C80L,C118S](Human)
Frontier Medicines
US Patent
Frontier Medicines
US Patent
Affinity DataIC50: 10nMAssay Description:The AlphaScreen technology was used to determine IC50S for compound inhibition of KRAS G12C (present as the Cys-light (C51S, C80L and C118S), truncat...More data for this Ligand-Target Pair
