BDBM736104 US20250129104, Compound 3115
SMILES [2H]C([2H])([2H])Oc1nc(N[C@H]2CC[C@@H](OC)CC2)nc2[nH]cc(-c3ccc4nnn(C)c4c3)c12
InChI Key
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 1 hit for monomerid = 736104
TargetDual specificity tyrosine-phosphorylation-regulated kinase 1A(Human)
Biosplice Therapeutics
US Patent
Biosplice Therapeutics
US Patent
Affinity DataEC50: 1.30nMAssay Description:Each compound was dissolved in DMSO as a 10 mM stock and used to prepare compound source plates. Serial dilution (1:3, 11-point dose-response curves ...More data for this Ligand-Target Pair
